EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O8 |
| Net Charge | 0 |
| Average Mass | 414.410 |
| Monoisotopic Mass | 414.13147 |
| SMILES | [H][C@]12COC(=O)[C@]1([H])[C@H](c1cc(OC)c(OC)c(OC)c1)c1cc3c(cc1[C@@H]2O)OCO3 |
| InChI | InChI=1S/C22H22O8/c1-25-16-4-10(5-17(26-2)21(16)27-3)18-11-6-14-15(30-9-29-14)7-12(11)20(23)13-8-28-22(24)19(13)18/h4-7,13,18-20,23H,8-9H2,1-3H3/t13-,18+,19-,20-/m0/s1 |
| InChIKey | YJGVMLPVUAXIQN-XVVDYKMHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | tubulin modulator Any substance that interacts with tubulin to inhibit or promote polymerisation of microtubules. antimitotic Any compound that inhibits cell division (mitosis). microtubule-destabilising agent Any substance that interacts with tubulin to inhibit polymerisation of microtubules. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. keratolytic drug A drug that softens, separates, and causes desquamation of the cornified epithelium or horny layer of skin. Keratolytic drugs are used to expose mycelia of infecting fungi or to treat corns, warts, and certain other skin diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| podophyllotoxin (CHEBI:50305) has role antimitotic (CHEBI:64911) |
| podophyllotoxin (CHEBI:50305) has role antineoplastic agent (CHEBI:35610) |
| podophyllotoxin (CHEBI:50305) has role keratolytic drug (CHEBI:50176) |
| podophyllotoxin (CHEBI:50305) has role microtubule-destabilising agent (CHEBI:61951) |
| podophyllotoxin (CHEBI:50305) has role plant metabolite (CHEBI:76924) |
| podophyllotoxin (CHEBI:50305) has role tubulin modulator (CHEBI:60832) |
| podophyllotoxin (CHEBI:50305) is a furonaphthodioxole (CHEBI:50307) |
| podophyllotoxin (CHEBI:50305) is a lignan (CHEBI:25036) |
| podophyllotoxin (CHEBI:50305) is a organic heterotetracyclic compound (CHEBI:38163) |
| Incoming Relation(s) |
| etoposide (CHEBI:4911) has functional parent podophyllotoxin (CHEBI:50305) |
| teniposide (CHEBI:75988) has functional parent podophyllotoxin (CHEBI:50305) |
| IUPAC Name |
|---|
| (5R,5aR,8aR,9R)-9-hydroxy-5-(3,4,5-trimethoxyphenyl)-5,8,8a,9-tetrahydrofuro[3',4':6,7]naphtho[2,3-d][1,3]dioxol-6(5aH)-one |
| Synonyms | Source |
|---|---|
| 9-HYDROXY-5-(3,4,5-TRIMETHOXYPHENYL)-5,8,8A,9-TETRAHYDROFURO[3',4':6,7]NAPHTHO[2,3-D][1,3]DIOXOL-6(5AH)-ONE | PDBeChem |
| Podofilox | ChemIDplus |
| Podophyllinic acid lactone | ChemIDplus |
| (−)-podophyllotoxin | ChEBI |
| Podophyllotoxin | KEGG COMPOUND |
| PPT | ChEBI |
| Brand Names | Source |
|---|---|
| Condylox | KEGG DRUG |
| Podophyllotoxin 7 | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 3481 | DrugCentral |
| C00000610 | KNApSAcK |
| C10874 | KEGG COMPOUND |
| D05529 | KEGG DRUG |
| DB01179 | DrugBank |
| HMDB0031452 | HMDB |
| LSM-3055 | LINCS |
| POD | PDBeChem |
| Podophyllotoxin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:99163 | Reaxys |
| CAS:518-28-5 | ChemIDplus |
| CAS:518-28-5 | KEGG COMPOUND |
| Citations |
|---|