EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H32O13 |
| Net Charge | 0 |
| Average Mass | 588.562 |
| Monoisotopic Mass | 588.18429 |
| SMILES | [H][C@]12COC(=O)[C@]1([H])[C@H](c1cc(OC)c(O)c(OC)c1)c1cc3c(cc1[C@H]2O[C@@H]1O[C@@H]2CO[C@@H](C)O[C@H]2[C@H](O)[C@H]1O)OCO3 |
| InChI | InChI=1S/C29H32O13/c1-11-36-9-20-27(40-11)24(31)25(32)29(41-20)42-26-14-7-17-16(38-10-39-17)6-13(14)21(22-15(26)8-37-28(22)33)12-4-18(34-2)23(30)19(5-12)35-3/h4-7,11,15,20-22,24-27,29-32H,8-10H2,1-3H3/t11-,15+,20-,21-,22+,24-,25-,26-,27-,29+/m1/s1 |
| InChIKey | VJJPUSNTGOMMGY-MRVIYFEKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etoposide (CHEBI:4911) has functional parent 4'-demethylepipodophyllotoxin (CHEBI:74422) |
| etoposide (CHEBI:4911) has functional parent podophyllotoxin (CHEBI:50305) |
| etoposide (CHEBI:4911) has role antineoplastic agent (CHEBI:35610) |
| etoposide (CHEBI:4911) has role DNA synthesis inhibitor (CHEBI:59517) |
| etoposide (CHEBI:4911) is a furonaphthodioxole (CHEBI:50307) |
| etoposide (CHEBI:4911) is a organic heterotetracyclic compound (CHEBI:38163) |
| etoposide (CHEBI:4911) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (5S,5aR,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5,5a,6,8,8a,9-hexahydrofuro[3',4':6,7]naphtho[2,3-d][1,3]dioxol-5-yl 4,6-O-[(1R)-ethylidene]-β-D-glucopyranoside |
| INNs | Source |
|---|---|
| etoposide | ChemIDplus |
| Etoposido | ChemIDplus |
| etoposidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Etoposide | KEGG COMPOUND |
| VP-16 | KEGG COMPOUND |
| 4'-Demethylepipodophyllotoxin 9-(4,6-O-(R)-ethylidene-beta-D-glucopyranoside) | ChemIDplus |
| 9-((4,6-O-Ethylidine-beta-D-glucopyranosyl)oxy)-5,8,8a,9-tetrahydro-5-(4-hydroxy-3,4-dimethyloxyphenyl)furo(3',4'':6,7)naptho-(2,3-d)-1,3-dioxol-6(5aH)-one | ChemIDplus |
| (−)-etoposide | DrugBank |
| trans-Etoposide | DrugBank |
| Brand Names | Source |
|---|---|
| Lastet | DrugBank |
| Vepesid | DrugBank |
| Eposin | DrugBank |
| Etopophos | DrugBank |
| Toposar | DrugBank |