EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H32O13S |
| Net Charge | 0 |
| Average Mass | 656.662 |
| Monoisotopic Mass | 656.15636 |
| SMILES | [H][C@@]1(c2cccs2)OC[C@@]2([H])O[C@@H](O[C@@H]3c4cc5c(cc4[C@@H](c4cc(OC)c(O)c(OC)c4)[C@@]4([H])C(=O)OC[C@]34[H])OCO5)[C@H](O)[C@@H](O)[C@]2([H])O1 |
| InChI | InChI=1S/C32H32O13S/c1-37-19-6-13(7-20(38-2)25(19)33)23-14-8-17-18(42-12-41-17)9-15(14)28(16-10-39-30(36)24(16)23)44-32-27(35)26(34)29-21(43-32)11-40-31(45-29)22-4-3-5-46-22/h3-9,16,21,23-24,26-29,31-35H,10-12H2,1-2H3/t16-,21+,23+,24-,26+,27+,28+,29+,31+,32-/m0/s1 |
| InChIKey | NRUKOCRGYNPUPR-QBPJDGROSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| teniposide (CHEBI:75988) has functional parent podophyllotoxin (CHEBI:50305) |
| teniposide (CHEBI:75988) has role antineoplastic agent (CHEBI:35610) |
| teniposide (CHEBI:75988) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| teniposide (CHEBI:75988) is a aromatic ether (CHEBI:35618) |
| teniposide (CHEBI:75988) is a cyclic acetal (CHEBI:59770) |
| teniposide (CHEBI:75988) is a furonaphthodioxole (CHEBI:50307) |
| teniposide (CHEBI:75988) is a monosaccharide derivative (CHEBI:63367) |
| teniposide (CHEBI:75988) is a phenols (CHEBI:33853) |
| teniposide (CHEBI:75988) is a thiophenes (CHEBI:26961) |
| teniposide (CHEBI:75988) is a β-D-glucoside (CHEBI:22798) |
| teniposide (CHEBI:75988) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (5S,5aR,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5,5a,6,8,8a,9-hexahydrofuro[3',4':6,7]naphtho[2,3-d][1,3]dioxol-5-yl 4,6-O-(thiophen-2-ylmethylidene)-β-D-glucopyranoside |
| INNs | Source |
|---|---|
| teniposide | KEGG DRUG |
| téniposide | WHO MedNet |
| tenipósido | DrugBank |
| teniposidum | DrugBank |
| Synonyms | Source |
|---|---|
| 4'-Demethylepipodophyllotoxin 9-(4,6-O-2-thenylidene-beta-D-glucopyranoside) | ChemIDplus |
| 4'-Demethylepipodophyllotoxin-beta-D-thenylidene glucoside | ChemIDplus |
| HSDB 6546 | ChemIDplus |
| NSC 122819 | ChemIDplus |
| NSC-122819 | ChemIDplus |
| VM-26 | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Vumon | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2590 | DrugCentral |
| 9TP | PDBeChem |
| C11153 | KEGG COMPOUND |
| CPD-16755 | MetaCyc |
| D02698 | KEGG DRUG |
| DB00444 | DrugBank |
| HMDB0014587 | HMDB |
| Teniposide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1417328 | Reaxys |
| CAS:29767-20-2 | KEGG COMPOUND |
| CAS:29767-20-2 | ChemIDplus |
| Citations |
|---|