EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18N5O14P3 |
| Net Charge | 0 |
| Average Mass | 537.208 |
| Monoisotopic Mass | 537.00631 |
| SMILES | C[n+]1cn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)([O-])O)[C@@H](O)[C@H]2O)c2nc(N)nc(=O)c21 |
| InChI | InChI=1S/C11H18N5O14P3/c1-15-3-16(8-5(15)9(19)14-11(12)13-8)10-7(18)6(17)4(28-10)2-27-32(23,24)30-33(25,26)29-31(20,21)22/h3-4,6-7,10,17-18H,2H2,1H3,(H6-,12,13,14,19,20,21,22,23,24,25,26)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | DKVRNHPCAOHRSI-KQYNXXCUSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-methyl-GTP (CHEBI:50210) has functional parent GTP (CHEBI:15996) |
| 7-methyl-GTP (CHEBI:50210) is a guanosine 5'-phosphate (CHEBI:37121) |
| 7-methyl-GTP (CHEBI:50210) is conjugate acid of 7-methyl-GTP(3−) (CHEBI:87133) |
| 7-methyl-GTP (CHEBI:50210) is conjugate base of 7-methyl-GTP(1+) (CHEBI:50226) |
| Incoming Relation(s) |
| 7-methyl-guanosine-5'-triphosphate-5'-guanosine (CHEBI:191209) has functional parent 7-methyl-GTP (CHEBI:50210) |
| 7-methyl-GTP(1+) (CHEBI:50226) is conjugate acid of 7-methyl-GTP (CHEBI:50210) |
| 7-methyl-GTP(3−) (CHEBI:87133) is conjugate base of 7-methyl-GTP (CHEBI:50210) |
| IUPAC Name |
|---|
| 7-methylguanosine 5'-(trihydrogen triphosphate) |
| Synonyms | Source |
|---|---|
| 7-methylguanosine triphosphate | ChemIDplus |
| 7-methylguanosine 5'-triphosphate | ChemIDplus |
| m7GTP | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4083086 | Beilstein |
| CAS:26554-26-7 | ChemIDplus |