EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C15H13O3.Ca |
| Net Charge | 0 |
| Average Mass | 522.610 |
| Monoisotopic Mass | 522.13553 |
| SMILES | CC(C(=O)[O-])c1cccc(Oc2ccccc2)c1.CC(C(=O)[O-])c1cccc(Oc2ccccc2)c1.[Ca+2] |
| InChI | InChI=1S/2C15H14O3.Ca/c2*1-11(15(16)17)12-6-5-9-14(10-12)18-13-7-3-2-4-8-13;/h2*2-11H,1H3,(H,16,17);/q;;+2/p-2 |
| InChIKey | VHUXSAWXWSTUOD-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Roles: | cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenoprofen calcium (anhydrous) (CHEBI:5010) has part fenoprofen(1−) (CHEBI:60566) |
| fenoprofen calcium (anhydrous) (CHEBI:5010) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| fenoprofen calcium (anhydrous) (CHEBI:5010) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| fenoprofen calcium (anhydrous) (CHEBI:5010) is a calcium salt (CHEBI:35156) |
| Incoming Relation(s) |
| fenoprofen calcium (CHEBI:5005) has part fenoprofen calcium (anhydrous) (CHEBI:5010) |
| IUPAC Name |
|---|
| calcium bis[2-(3-phenoxyphenyl)propanoate] |
| Synonyms | Source |
|---|---|
| anhydrous fenoprofen calcium | ChEBI |
| calcium (±)-2-(3-phenoxyphenyl)propionate | ChEBI |
| calcium 2-(3-phenoxyphenyl)propionate | ChEBI |
| calcium 2-(m-phenoxyphenyl)propionate | ChEBI |
| calcium α-(m-phenoxyphenyl)propionate | ChEBI |
| calcium α-methyl-3-phenoxybenzeneacetate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C02539 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6029012 | Reaxys |
| CAS:34597-40-5 | ChemIDplus |