EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N2O2S |
| Net Charge | 0 |
| Average Mass | 164.230 |
| Monoisotopic Mass | 164.06195 |
| SMILES | NCCSC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H12N2O2S/c6-1-2-10-3-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1 |
| InChIKey | GHSJKUNUIHUPDF-BYPYZUCNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 5.4.3.2 (lysine 2,3-aminomutase) inhibitor An EC 5.4.3.* (intramolecular transferase transferring amino groups) inhibitor that interferes with the action of lysine 2,3-aminomutase (EC 5.4.3.2). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-thialysine (CHEBI:497734) has role EC 5.4.3.2 (lysine 2,3-aminomutase) inhibitor (CHEBI:75190) |
| L-thialysine (CHEBI:497734) has role metabolite (CHEBI:25212) |
| L-thialysine (CHEBI:497734) has role protein synthesis inhibitor (CHEBI:48001) |
| L-thialysine (CHEBI:497734) is a L-cysteine thioether (CHEBI:27532) |
| L-thialysine (CHEBI:497734) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-thialysine (CHEBI:497734) is conjugate base of L-thialysinium (CHEBI:156132) |
| Incoming Relation(s) |
| N-acetyl-L-thialysine (CHEBI:156139) has functional parent L-thialysine (CHEBI:497734) |
| L-thialysinium (CHEBI:156132) is conjugate acid of L-thialysine (CHEBI:497734) |
| IUPAC Name |
|---|
| S-(2-aminoethyl)-L-cysteine |
| Synonyms | Source |
|---|---|
| 2-Aminoethylcysteine | HMDB |
| (2R)-2-amino-3-(2-aminoethylsulfanyl)propanoic acid | PDB |
| 4-Thia-L-lysine | HMDB |
| 4-Thialysine | HMDB |
| Aminoethylcysteine | ChemIDplus |
| gamma-Thia-lys | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033518 | HMDB |
| S-Aminoethyl-L-cysteine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1006349 | Gmelin |
| Reaxys:1705488 | Reaxys |
| CAS:2936-69-8 | ChemIDplus |
| Citations |
|---|