EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H13N2O2S |
| Net Charge | +1 |
| Average Mass | 165.238 |
| Monoisotopic Mass | 165.06923 |
| SMILES | [NH3+]CCSC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C5H12N2O2S/c6-1-2-10-3-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/p+1/t4-/m0/s1 |
| InChIKey | GHSJKUNUIHUPDF-BYPYZUCNSA-O |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-thialysinium (CHEBI:156132) is a S-substituted L-cysteine (CHEBI:47910) |
| L-thialysinium (CHEBI:156132) is conjugate acid of L-thialysine (CHEBI:497734) |
| Incoming Relation(s) |
| N-acetyl-L-thialysine zwitterion (CHEBI:156134) has functional parent L-thialysinium (CHEBI:156132) |
| L-thialysine (CHEBI:497734) is conjugate base of L-thialysinium (CHEBI:156132) |
| Synonym | Source |
|---|---|
| S-(β-aminoethyl)-L-cysteine | SUBMITTER |
| UniProt Name | Source |
|---|---|
| S-(2-aminoethyl)-L-cysteine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| S-2-AMINOETHYL-L-CYSTEINE | MetaCyc |
| Citations |
|---|