EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O3S |
| Net Charge | 0 |
| Average Mass | 206.267 |
| Monoisotopic Mass | 206.07251 |
| SMILES | CC(=O)NCCSC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H14N2O3S/c1-5(10)9-2-3-13-4-6(8)7(11)12/h6H,2-4,8H2,1H3,(H,9,10)(H,11,12)/t6-/m0/s1 |
| InChIKey | NTYDEVWJGFRRKF-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-thialysine (CHEBI:156139) has functional parent L-thialysine (CHEBI:497734) |
| N-acetyl-L-thialysine (CHEBI:156139) is a L-cysteine thioether (CHEBI:27532) |
| N-acetyl-L-thialysine (CHEBI:156139) is a acetamides (CHEBI:22160) |
| N-acetyl-L-thialysine (CHEBI:156139) is tautomer of N-acetyl-L-thialysine zwitterion (CHEBI:156134) |
| Incoming Relation(s) |
| N-acetyl-L-thialysine zwitterion (CHEBI:156134) is tautomer of N-acetyl-L-thialysine (CHEBI:156139) |
| IUPAC Name |
|---|
| S-(2-acetamidoethyl)-L-cysteine |
| Synonyms | Source |
|---|---|
| (2R)-3-[(2-acetamidoethyl)sulfanyl]-2-aminopropanoic acid | IUPAC |
| N-acetyl-L-thialysine | ChEBI |
| S-(2-N-acetylaminoethyl)-L-cysteine | ChEBI |
| epsilon-N-acetylthialysine | ChEBI |
| ε-N-acetyl-L-thialysine | ChEBI |
| ε-N-acetylthialysine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:20662-33-3 | ChemIDplus |
| Citations |
|---|