EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N3O7 |
| Net Charge | 0 |
| Average Mass | 363.326 |
| Monoisotopic Mass | 363.10665 |
| SMILES | O=c1nc2n(C[C@H](O)[C@H](O)[C@H](O)CO)c3cc(O)ccc3cc-2c(=O)n1 |
| InChI | InChI=1S/C16H17N3O7/c20-6-12(23)13(24)11(22)5-19-10-4-8(21)2-1-7(10)3-9-14(19)17-16(26)18-15(9)25/h1-4,11-13,20-24H,5-6H2,(H,18,25,26)/t11-,12+,13-/m0/s1 |
| InChIKey | AUEILLWDYUBWCM-XQQFMLRXSA-N |
| Roles Classification |
|---|
| Biological Role: | prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,8-didemethyl-8-hydroxy-5-deazariboflavin (CHEBI:43034) has functional parent riboflavin (CHEBI:17015) |
| 7,8-didemethyl-8-hydroxy-5-deazariboflavin (CHEBI:43034) has role prosthetic group (CHEBI:26348) |
| 7,8-didemethyl-8-hydroxy-5-deazariboflavin (CHEBI:43034) is a pyrimidoquinolines (CHEBI:59535) |
| 7,8-didemethyl-8-hydroxy-5-deazariboflavin (CHEBI:43034) is conjugate acid of 7,8-didemethyl-8-hydroxy-5-deazariboflavin(1−) (CHEBI:59904) |
| Incoming Relation(s) |
| coenzyme F390-A (CHEBI:62784) has functional parent 7,8-didemethyl-8-hydroxy-5-deazariboflavin (CHEBI:43034) |
| coenzyme F390-G (CHEBI:62786) has functional parent 7,8-didemethyl-8-hydroxy-5-deazariboflavin (CHEBI:43034) |
| coenzyme F420-1 (CHEBI:59536) has functional parent 7,8-didemethyl-8-hydroxy-5-deazariboflavin (CHEBI:43034) |
| coenzyme F420-1(3−) (CHEBI:59543) has functional parent 7,8-didemethyl-8-hydroxy-5-deazariboflavin (CHEBI:43034) |
| coenzyme F420-6 (CHEBI:63314) has functional parent 7,8-didemethyl-8-hydroxy-5-deazariboflavin (CHEBI:43034) |
| coenzyme α-F420-3 (CHEBI:59537) has functional parent 7,8-didemethyl-8-hydroxy-5-deazariboflavin (CHEBI:43034) |
| coenzyme γ-F420-2 (CHEBI:16848) has functional parent 7,8-didemethyl-8-hydroxy-5-deazariboflavin (CHEBI:43034) |
| coenzyme γ-F420-2(4−) (CHEBI:59541) has functional parent 7,8-didemethyl-8-hydroxy-5-deazariboflavin (CHEBI:43034) |
| reduced coenzyme F420-(γ-Glu)n polyanion (CHEBI:139511) has functional parent 7,8-didemethyl-8-hydroxy-5-deazariboflavin (CHEBI:43034) |
| 7,8-didemethyl-8-hydroxy-5-deazariboflavin(1−) (CHEBI:59904) is conjugate base of 7,8-didemethyl-8-hydroxy-5-deazariboflavin (CHEBI:43034) |
| IUPAC Name |
|---|
| 1-deoxy-1-(8-hydroxy-2,4-dioxo-3,4-dihydropyrimido[4,5-b]quinolin-10(2H)-yl)-D-ribitol |
| Synonyms | Source |
|---|---|
| 1-deoxy-1-(8-hydroxy-2,4-dioxo-3,4-dihydropyrimido[4,5-b]quinolin-10(2H)-yl)-D-ribitol | PDBeChem |
| 8-HDF | ChEBI |
| 8-HYDROXY-10-(D-RIBO-2,3,4,5-TETRAHYDROXYPENTYL)-5-DEAZAISOALLOXAZINE | PDBeChem |
| 8-hydroxy-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)pyrimido[4,5-b]quinoline-2,4(3H,10H)-dione | IUPAC |
| 8-hydroxy-5-deazaflavin | ChemIDplus |
| FO | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4580764 | Beilstein |
| CAS:37333-48-5 | ChemIDplus |
| CAS:37333-48-5 | KEGG COMPOUND |
| Citations |
|---|