EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26N4O15P |
| Net Charge | -3 |
| Average Mass | 641.459 |
| Monoisotopic Mass | 641.11487 |
| SMILES | C[C@H](OP(=O)([O-])OC[C@@H](O)[C@@H](O)[C@@H](O)Cn1c2nc(=O)nc(=O)c-2cc2ccc(O)cc21)C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C24H29N4O15P/c1-10(21(35)25-14(23(37)38)4-5-18(32)33)43-44(40,41)42-9-17(31)19(34)16(30)8-28-15-7-12(29)3-2-11(15)6-13-20(28)26-24(39)27-22(13)36/h2-3,6-7,10,14,16-17,19,29-31,34H,4-5,8-9H2,1H3,(H,25,35)(H,32,33)(H,37,38)(H,40,41)(H,27,36,39)/p-3/t10-,14-,16-,17+,19-/m0/s1 |
| InChIKey | WVEYWCGUSMKKMF-LADHFWMSSA-K |
| Roles Classification |
|---|
| Biological Role: | coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coenzyme F420-1(3−) (CHEBI:59543) has functional parent 7,8-didemethyl-8-hydroxy-5-deazariboflavin (CHEBI:43034) |
| coenzyme F420-1(3−) (CHEBI:59543) has role coenzyme (CHEBI:23354) |
| coenzyme F420-1(3−) (CHEBI:59543) is a dialkyl phosphate anion (CHEBI:58944) |
| coenzyme F420-1(3−) (CHEBI:59543) is a dicarboxylic acid dianion (CHEBI:28965) |
| coenzyme F420-1(3−) (CHEBI:59543) is a pyrimidoquinolines (CHEBI:59535) |
| coenzyme F420-1(3−) (CHEBI:59543) is a ribitol phosphate (CHEBI:26554) |
| coenzyme F420-1(3−) (CHEBI:59543) is conjugate acid of coenzyme F420-1(4−) (CHEBI:59920) |
| coenzyme F420-1(3−) (CHEBI:59543) is conjugate base of coenzyme F420-1 (CHEBI:59536) |
| Incoming Relation(s) |
| coenzyme F420-1 (CHEBI:59536) is conjugate acid of coenzyme F420-1(3−) (CHEBI:59543) |
| coenzyme F420-1(4−) (CHEBI:59920) is conjugate base of coenzyme F420-1(3−) (CHEBI:59543) |
| IUPAC Name |
|---|
| 1-deoxy-5-O-({[(2S)-1-{[(1S)-1,3-dicarboxylatopropyl]amino}-1-oxopropan-2-yl]oxy}phosphinato)-1-(8-hydroxy-2,4-dioxo-3,4-dihydropyrimido[4,5-b]quinolin-10(2H)-yl)-D-ribitol |
| Synonym | Source |
|---|---|
| F420-1(3−) | ChEBI |
| Citations |
|---|