EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H43N6O21P |
| Net Charge | 0 |
| Average Mass | 902.713 |
| Monoisotopic Mass | 902.22189 |
| SMILES | C[C@H](OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)Cn1c2nc(=O)nc(=O)c-2cc2ccc(O)cc21)C(=O)N[C@@H](CCC(=O)N[C@@H](CCC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C34H43N6O21P/c1-14(29(49)37-20(33(55)56)5-8-25(45)35-18(31(51)52)4-7-24(44)36-19(32(53)54)6-9-26(46)47)61-62(58,59)60-13-23(43)27(48)22(42)12-40-21-11-16(41)3-2-15(21)10-17-28(40)38-34(57)39-30(17)50/h2-3,10-11,14,18-20,22-23,27,41-43,48H,4-9,12-13H2,1H3,(H,35,45)(H,36,44)(H,37,49)(H,46,47)(H,51,52)(H,53,54)(H,55,56)(H,58,59)(H,39,50,57)/t14-,18-,19-,20-,22-,23+,27-/m0/s1 |
| InChIKey | YHDAXCLOUDHUAA-LROHGRLLSA-N |
| Roles Classification |
|---|
| Biological Role: | coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coenzyme α-F420-3 (CHEBI:59537) has functional parent 7,8-didemethyl-8-hydroxy-5-deazariboflavin (CHEBI:43034) |
| coenzyme α-F420-3 (CHEBI:59537) has role coenzyme (CHEBI:23354) |
| coenzyme α-F420-3 (CHEBI:59537) is a pyrimidoquinolines (CHEBI:59535) |
| coenzyme α-F420-3 (CHEBI:59537) is a ribitol phosphate (CHEBI:26554) |
| coenzyme α-F420-3 (CHEBI:59537) is conjugate acid of coenzyme α-F420-3(5−) (CHEBI:59539) |
| Incoming Relation(s) |
| coenzyme α-F420-3(5−) (CHEBI:59539) is conjugate base of coenzyme α-F420-3 (CHEBI:59537) |
| IUPAC Name |
|---|
| N-(N-{O-[1-(8-hydroxy-2,4-dioxo-2,3,4,10-tetrahydropyrimido[4,5-b]quinolin-10-yl)-1-deoxy-D-ribityl-5-phospho]-(S)-lactyl}-γ-L-glutamyl-γ-L-glutamyl)-L-glutamic acid |
| Synonym | Source |
|---|---|
| α-F420-3 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C19151 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:106324-58-7 | KEGG COMPOUND |
| Citations |
|---|