EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H32N5O18P |
| Net Charge | -4 |
| Average Mass | 769.566 |
| Monoisotopic Mass | 769.15019 |
| SMILES | C[C@H](OP(=O)([O-])OC[C@@H](O)[C@@H](O)[C@@H](O)Cn1c2nc(=O)nc(=O)c-2cc2ccc(O)cc21)C(=O)N[C@@H](CCC(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C29H36N5O18P/c1-12(25(42)31-17(28(46)47)4-6-21(38)30-16(27(44)45)5-7-22(39)40)52-53(49,50)51-11-20(37)23(41)19(36)10-34-18-9-14(35)3-2-13(18)8-15-24(34)32-29(48)33-26(15)43/h2-3,8-9,12,16-17,19-20,23,35-37,41H,4-7,10-11H2,1H3,(H,30,38)(H,31,42)(H,39,40)(H,44,45)(H,46,47)(H,49,50)(H,33,43,48)/p-4/t12-,16-,17-,19-,20+,23-/m0/s1 |
| InChIKey | GEHSZWRGPHDXJO-NALJQGANSA-J |
| Roles Classification |
|---|
| Biological Role: | coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coenzyme γ-F420-2(4−) (CHEBI:59541) has functional parent 7,8-didemethyl-8-hydroxy-5-deazariboflavin (CHEBI:43034) |
| coenzyme γ-F420-2(4−) (CHEBI:59541) has role coenzyme (CHEBI:23354) |
| coenzyme γ-F420-2(4−) (CHEBI:59541) is a dialkyl phosphate anion (CHEBI:58944) |
| coenzyme γ-F420-2(4−) (CHEBI:59541) is a pyrimidoquinolines (CHEBI:59535) |
| coenzyme γ-F420-2(4−) (CHEBI:59541) is a ribitol phosphate (CHEBI:26554) |
| coenzyme γ-F420-2(4−) (CHEBI:59541) is a tricarboxylic acid anion (CHEBI:35753) |
| coenzyme γ-F420-2(4−) (CHEBI:59541) is conjugate base of coenzyme γ-F420-2 (CHEBI:16848) |
| Incoming Relation(s) |
| coenzyme γ-F420-2 (CHEBI:16848) is conjugate acid of coenzyme γ-F420-2(4−) (CHEBI:59541) |
| IUPAC Name |
|---|
| 5-O-({[(2S)-1-{[(1S)-1-carboxylato-4-{[(1S)-1,3-dicarboxylatopropyl]amino}-4-oxobutyl]amino}-1-oxopropan-2-yl]oxy}phosphinato)-1-deoxy-1-(8-hydroxy-2,4-dioxo-3,4-dihydropyrimido[4,5-b]quinolin-10(2H)-yl)-D-ribitol |
| Synonym | Source |
|---|---|
| γ-F420-2(4−) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7109687 | Beilstein |
| Citations |
|---|