EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H30O26 |
| Net Charge | 0 |
| Average Mass | 938.665 |
| Monoisotopic Mass | 938.10253 |
| SMILES | O=C(O[C@@H]1O[C@@H]2COC(=O)c3cc(O)c(O)c(O)c3-c3c(cc(O)c(O)c3O)C(=O)O[C@H]2[C@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@H]1OC(=O)c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C41H30O26/c42-15-1-10(2-16(43)26(15)50)36(57)65-34-33-23(9-62-39(60)13-7-21(48)29(53)31(55)24(13)25-14(40(61)64-33)8-22(49)30(54)32(25)56)63-41(67-38(59)12-5-19(46)28(52)20(47)6-12)35(34)66-37(58)11-3-17(44)27(51)18(45)4-11/h1-8,23,33-35,41-56H,9H2/t23-,33-,34+,35-,41+/m1/s1 |
| InChIKey | JCGHAEBIBSEQAD-UUUCSUBKSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eugenia caryophyllata (IPNI:593931-1) | flower bud (BTO:0000470) | PubMed (10737184) | Dried flower bud |
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HSV-1 agent An anti-HSV agent agent that destroys or inhibits the replication of herpes simplex virus-1. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eugeniin (CHEBI:4916) has functional parent gallic acid (CHEBI:30778) |
| eugeniin (CHEBI:4916) has role anti-HSV-1 agent (CHEBI:64953) |
| eugeniin (CHEBI:4916) has role antifungal agent (CHEBI:35718) |
| eugeniin (CHEBI:4916) has role antineoplastic agent (CHEBI:35610) |
| eugeniin (CHEBI:4916) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| eugeniin (CHEBI:4916) has role metabolite (CHEBI:25212) |
| eugeniin (CHEBI:4916) is a ellagitannin (CHEBI:23909) |
| eugeniin (CHEBI:4916) is a gallate ester (CHEBI:37576) |
| eugeniin (CHEBI:4916) is a lactone (CHEBI:25000) |
| eugeniin (CHEBI:4916) is a β-D-glucoside (CHEBI:22798) |
| eugeniin (CHEBI:4916) is conjugate acid of tellimagrandin II(2−) (CHEBI:145905) |
| Incoming Relation(s) |
| tellimagrandin II(2−) (CHEBI:145905) is conjugate base of eugeniin (CHEBI:4916) |
| IUPAC Name |
|---|
| (11aR,13S,14R,15S,15aR)-2,3,4,5,6,7-hexahydroxy-9,17-dioxo-9,11,11a,13,14,15,15a,17-octahydrodibenzo[g,i]pyrano[3,2-b][1,5]dioxacycloundecine-13,14,15-triyl tris(3,4,5-trihydroxybenzoate) |
| Synonyms | Source |
|---|---|
| 1,2,3-trigalloyl-4,6-hexahydroxydiphenoyl β-D-glucopyranose | ChEBI |
| Cornustannin 2 | HMDB |
| Eugeniin | KEGG COMPOUND |
| Tellimagrandin II | KEGG COMPOUND |
| β-D-Glucopyranose,cyclic4,6-(4,4',5,5',6,6'-hexahydroxy(1,1'-biphenyl)-2,2'-dicarboxylate)1,2,3-tris(3,4,5-trihydroxybenzoate) | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00002920 | KNApSAcK |
| C10224 | KEGG COMPOUND |
| CPD-8949 | MetaCyc |
| HMDB0039265 | HMDB |
| Tellimagrandin_II | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9038164 | Reaxys |
| CAS:58970-75-5 | KEGG COMPOUND |
| Citations |
|---|