EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H30O26 |
| Net Charge | 0 |
| Average Mass | 938.665 |
| Monoisotopic Mass | 938.10253 |
| SMILES | O=C(O[C@@H]1O[C@@H]2COC(=O)c3cc(O)c(O)c(O)c3-c3c(cc(O)c(O)c3O)C(=O)O[C@H]2[C@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@H]1OC(=O)c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C41H30O26/c42-15-1-10(2-16(43)26(15)50)36(57)65-34-33-23(9-62-39(60)13-7-21(48)29(53)31(55)24(13)25-14(40(61)64-33)8-22(49)30(54)32(25)56)63-41(67-38(59)12-5-19(46)28(52)20(47)6-12)35(34)66-37(58)11-3-17(44)27(51)18(45)4-11/h1-8,23,33-35,41-56H,9H2/t23-,33-,34+,35-,41+/m1/s1 |
| InChIKey | JCGHAEBIBSEQAD-UUUCSUBKSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eugenia caryophyllata (IPNI:593931-1) | flower bud (BTO:0000470) | PubMed (10737184) | Dried flower bud |
| Roles Classification |
|---|
| Biological Roles: | anti-HSV-1 agent An anti-HSV agent agent that destroys or inhibits the replication of herpes simplex virus-1. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eugeniin (CHEBI:4916) has functional parent gallic acid (CHEBI:30778) |
| eugeniin (CHEBI:4916) has role anti-HSV-1 agent (CHEBI:64953) |
| eugeniin (CHEBI:4916) has role antifungal agent (CHEBI:35718) |
| eugeniin (CHEBI:4916) has role antineoplastic agent (CHEBI:35610) |
| eugeniin (CHEBI:4916) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| eugeniin (CHEBI:4916) has role metabolite (CHEBI:25212) |
| eugeniin (CHEBI:4916) is a ellagitannin (CHEBI:23909) |
| eugeniin (CHEBI:4916) is a gallate ester (CHEBI:37576) |
| eugeniin (CHEBI:4916) is a lactone (CHEBI:25000) |
| eugeniin (CHEBI:4916) is a β-D-glucoside (CHEBI:22798) |
| eugeniin (CHEBI:4916) is conjugate acid of tellimagrandin II(2−) (CHEBI:145905) |
| Incoming Relation(s) |
| tellimagrandin II(2−) (CHEBI:145905) is conjugate base of eugeniin (CHEBI:4916) |
| IUPAC Name |
|---|
| (11aR,13S,14R,15S,15aR)-2,3,4,5,6,7-hexahydroxy-9,17-dioxo-9,11,11a,13,14,15,15a,17-octahydrodibenzo[g,i]pyrano[3,2-b][1,5]dioxacycloundecine-13,14,15-triyl tris(3,4,5-trihydroxybenzoate) |
| Synonyms | Source |
|---|---|
| Eugeniin | KEGG COMPOUND |
| Tellimagrandin II | KEGG COMPOUND |
| β-D-Glucopyranose,cyclic4,6-(4,4',5,5',6,6'-hexahydroxy(1,1'-biphenyl)-2,2'-dicarboxylate)1,2,3-tris(3,4,5-trihydroxybenzoate) | ChemIDplus |
| 1,2,3-trigalloyl-4,6-hexahydroxydiphenoyl β-D-glucopyranose | ChEBI |
| Cornustannin 2 | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C10224 | KEGG COMPOUND |
| Tellimagrandin_II | Wikipedia |
| HMDB0039265 | HMDB |
| C00002920 | KNApSAcK |
| CPD-8949 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9038164 | Reaxys |
| CAS:58970-75-5 | KEGG COMPOUND |
| Citations |
|---|