EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H28O26 |
| Net Charge | -2 |
| Average Mass | 936.649 |
| Monoisotopic Mass | 936.08798 |
| SMILES | O=C(O[C@@H]1O[C@@H]2COC(=O)c3cc(O)c(O)c(O)c3-c3c(cc(O)c(O)c3[O-])C(=O)O[C@H]2[C@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@H]1OC(=O)c1cc(O)c(O)c(O)c1)c1cc(O)c([O-])c(O)c1 |
| InChI | InChI=1S/C41H30O26/c42-15-1-10(2-16(43)26(15)50)36(57)65-34-33-23(9-62-39(60)13-7-21(48)29(53)31(55)24(13)25-14(40(61)64-33)8-22(49)30(54)32(25)56)63-41(67-38(59)12-5-19(46)28(52)20(47)6-12)35(34)66-37(58)11-3-17(44)27(51)18(45)4-11/h1-8,23,33-35,41-56H,9H2/p-2/t23-,33-,34+,35-,41+/m1/s1 |
| InChIKey | JCGHAEBIBSEQAD-UUUCSUBKSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tellimagrandin II(2−) (CHEBI:145905) is a phenolate anion (CHEBI:50525) |
| tellimagrandin II(2−) (CHEBI:145905) is conjugate base of eugeniin (CHEBI:4916) |
| Incoming Relation(s) |
| eugeniin (CHEBI:4916) is conjugate acid of tellimagrandin II(2−) (CHEBI:145905) |
| UniProt Name | Source |
|---|---|
| tellimagrandin II | UniProt |
| Citations |
|---|