EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O8 |
| Net Charge | 0 |
| Average Mass | 400.383 |
| Monoisotopic Mass | 400.11582 |
| SMILES | [H][C@]12COC(=O)[C@]1([H])[C@H](c1cc(OC)c(O)c(OC)c1)c1cc3c(cc1[C@H]2O)OCO3 |
| InChI | InChI=1S/C21H20O8/c1-25-15-3-9(4-16(26-2)20(15)23)17-10-5-13-14(29-8-28-13)6-11(10)19(22)12-7-27-21(24)18(12)17/h3-6,12,17-19,22-23H,7-8H2,1-2H3/t12-,17+,18-,19+/m0/s1 |
| InChIKey | YVCVYCSAAZQOJI-JHQYFNNDSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-demethylepipodophyllotoxin (CHEBI:74422) has role antineoplastic agent (CHEBI:35610) |
| 4'-demethylepipodophyllotoxin (CHEBI:74422) is a furonaphthodioxole (CHEBI:50307) |
| 4'-demethylepipodophyllotoxin (CHEBI:74422) is a organic heterotetracyclic compound (CHEBI:38163) |
| 4'-demethylepipodophyllotoxin (CHEBI:74422) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| etoposide (CHEBI:4911) has functional parent 4'-demethylepipodophyllotoxin (CHEBI:74422) |
| IUPAC Name |
|---|
| (5R,5aR,8aR,9S)-9-hydroxy-5-(4-hydroxy-3,5-dimethoxyphenyl)-5,8,8a,9-tetrahydrofuro[3',4':6,7]naphtho[2,3-d][1,3]dioxol-6(5aH)-one |
| Synonyms | Source |
|---|---|
| 4'-demethyl-9-epipodophyllotoxin | ChEBI |
| (−)-4'-demethylepipodophyllotoxin | ChEBI |
| 4'-O-demethyl-4-epipodophyllotoxin | ChEBI |
| 4'-O-demethylepipodophyllotoxin | ChEBI |
| DMEP | ChEBI |
| epi-4'-demethylpodophyllotoxin | ChEBI |
| UniProt Name | Source |
|---|---|
| 4'-demethylepipodophyllotoxin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1358259 | Reaxys |
| CAS:6559-91-7 | ChemIDplus |
| Citations |
|---|