EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O5 |
| Net Charge | 0 |
| Average Mass | 136.103 |
| Monoisotopic Mass | 136.03717 |
| SMILES | O=C(O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C4H8O5/c5-1-2(6)3(7)4(8)9/h2-3,5-7H,1H2,(H,8,9)/t2-,3-/m0/s1 |
| InChIKey | JPIJQSOTBSSVTP-HRFVKAFMSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-erythronic acid (CHEBI:49058) is a erythronic acid (CHEBI:37654) |
| L-erythronic acid (CHEBI:49058) is enantiomer of D-erythronic acid (CHEBI:37655) |
| Incoming Relation(s) |
| (S)-2-hydroxy-3-oxo-4-(phosphonooxy)butanoic acid (CHEBI:63322) has functional parent L-erythronic acid (CHEBI:49058) |
| 4-phospho-L-erythronic acid (CHEBI:49056) has functional parent L-erythronic acid (CHEBI:49058) |
| D-erythronic acid (CHEBI:37655) is enantiomer of L-erythronic acid (CHEBI:49058) |
| IUPAC Names |
|---|
| (2S,3S)-2,3,4-trihydroxybutanoic acid |
| L-erythronic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1722839 | Beilstein |