EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9O8P |
| Net Charge | 0 |
| Average Mass | 216.082 |
| Monoisotopic Mass | 216.00350 |
| SMILES | O=C(O)[C@@H](O)[C@@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C4H9O8P/c5-2(3(6)4(7)8)1-12-13(9,10)11/h2-3,5-6H,1H2,(H,7,8)(H2,9,10,11)/t2-,3-/m0/s1 |
| InChIKey | ZCZXOHUILRHRQJ-HRFVKAFMSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-phospho-L-erythronic acid (CHEBI:49056) has functional parent L-erythronic acid (CHEBI:49058) |
| 4-phospho-L-erythronic acid (CHEBI:49056) is a 4-phosphoerythronic acid (CHEBI:49055) |
| 4-phospho-L-erythronic acid (CHEBI:49056) is enantiomer of 4-phospho-D-erythronic acid (CHEBI:49003) |
| Incoming Relation(s) |
| 4-phospho-D-erythronic acid (CHEBI:49003) is enantiomer of 4-phospho-L-erythronic acid (CHEBI:49056) |
| IUPAC Names |
|---|
| (2S,3S)-2,3-dihydroxy-4-(phosphonooxy)butanoic acid |
| 4-O-phosphono-L-erythronic acid |