EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:37655 - D-erythronic acid
| Formula | C4H8O5 |
| Net Charge | 0 |
| Average Mass | 136.103 |
| Monoisotopic Mass | 136.03717 |
| SMILES | O=C(O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C4H8O5/c5-1-2(6)3(7)4(8)9/h2-3,5-7H,1H2,(H,8,9)/t2-,3-/m1/s1 |
| InChIKey | JPIJQSOTBSSVTP-PWNYCUMCSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-erythronic acid (CHEBI:37655) is a erythronic acid (CHEBI:37654) |
| D-erythronic acid (CHEBI:37655) is conjugate acid of D-erythronate (CHEBI:136591) |
| D-erythronic acid (CHEBI:37655) is enantiomer of L-erythronic acid (CHEBI:49058) |
| Incoming Relation(s) |
| 3-phospho-D-erythronic acid (CHEBI:1656) has functional parent D-erythronic acid (CHEBI:37655) |
| 4-phospho-D-erythronic acid (CHEBI:49003) has functional parent D-erythronic acid (CHEBI:37655) |
| D-erythronate (CHEBI:136591) is conjugate base of D-erythronic acid (CHEBI:37655) |
| L-erythronic acid (CHEBI:49058) is enantiomer of D-erythronic acid (CHEBI:37655) |
| IUPAC Names |
|---|
| (2R,3R)-2,3,4-trihydroxybutanoic acid |
| D-erythronic acid |
| Synonyms | Source |
|---|---|
| erythro-2,3,4-Trihydroxybutyric acid | HMDB |
| Erythronic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| CPD-19877 | MetaCyc |
| HMDB0000613 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1722840 | Reaxys |
| CAS:13752-84-6 | HMDB |