EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | CC1=CC(=O)[C@@H](C(C)C)CC1 |
| InChI | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)6-10(9)11/h6-7,9H,4-5H2,1-3H3/t9-/m1/s1 |
| InChIKey | YSTPAHQEHQSRJD-SECBINFHSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-piperitone (CHEBI:48934) is a piperitone (CHEBI:48933) |
| (−)-piperitone (CHEBI:48934) is enantiomer of (+)-piperitone (CHEBI:41) |
| Incoming Relation(s) |
| (+)-piperitone (CHEBI:41) is enantiomer of (−)-piperitone (CHEBI:48934) |
| IUPAC Name |
|---|
| (6R)-3-methyl-6-(propan-2-yl)cyclohex-2-en-1-one |
| Synonyms | Source |
|---|---|
| (6R)-6-isopropyl-3-methylcyclohex-2-en-1-one | IUPAC |
| (6R)-3-methyl-6-(1-methylethyl)-2-cyclohexen-1-one | ChemIDplus |
| l-piperitone | ChEBI |
| (R)-6-(Isopropyl)-3-methylcyclohex-2-en-1-one | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2206720 | Beilstein |
| CAS:4573-50-6 | ChemIDplus |