EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | CC1=CC(=O)C(C(C)C)CC1 |
| InChI | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)6-10(9)11/h6-7,9H,4-5H2,1-3H3 |
| InChIKey | YSTPAHQEHQSRJD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piperitone (CHEBI:48933) has role plant metabolite (CHEBI:76924) |
| piperitone (CHEBI:48933) has role volatile oil component (CHEBI:27311) |
| piperitone (CHEBI:48933) is a p-menthane monoterpenoid (CHEBI:25186) |
| piperitone (CHEBI:48933) is a cyclic terpene ketone (CHEBI:36130) |
| Incoming Relation(s) |
| (+)-piperitone (CHEBI:41) is a piperitone (CHEBI:48933) |
| (−)-piperitone (CHEBI:48934) is a piperitone (CHEBI:48933) |
| IUPAC Name |
|---|
| 3-methyl-6-(propan-2-yl)cyclohex-2-en-1-one |
| Synonyms | Source |
|---|---|
| 3-Carvomenthenone | ChemIDplus |
| 3-methyl-6-(1-methylethyl)-2-cyclohexen-1-one | ChemIDplus |
| 6-Isopropyl-3-methylcyclohex-2-enone | ChemIDplus |
| p-Menth-1-en-3-one | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0034975 | HMDB |
| Piperitone | Wikipedia |
| US2972632 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1907772 | Reaxys |
| CAS:89-81-6 | ChemIDplus |
| Citations |
|---|