EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | CC1=CC(=O)[C@H](C(C)C)CC1 |
| InChI | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)6-10(9)11/h6-7,9H,4-5H2,1-3H3/t9-/m0/s1 |
| InChIKey | YSTPAHQEHQSRJD-VIFPVBQESA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-piperitone (CHEBI:41) is a piperitone (CHEBI:48933) |
| (+)-piperitone (CHEBI:41) is enantiomer of (−)-piperitone (CHEBI:48934) |
| Incoming Relation(s) |
| (−)-piperitone (CHEBI:48934) is enantiomer of (+)-piperitone (CHEBI:41) |
| IUPAC Name |
|---|
| (6S)-3-methyl-6-(propan-2-yl)cyclohex-2-en-1-one |
| Synonyms | Source |
|---|---|
| alpha-Piperitone | ChemIDplus |
| d-Piperitone | KEGG COMPOUND |
| (S)-piperitone | ChEBI |
| (+)-Piperitone | KEGG COMPOUND |
| (S)-3-methyl-6-(1-methylethyl)-2-cyclohexen-1-one | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00003054 | KNApSAcK |
| C09885 | KEGG COMPOUND |
| LMPR0102090024 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2042974 | Reaxys |
| CAS:6091-50-5 | KEGG COMPOUND |
| CAS:6091-50-5 | ChemIDplus |