EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N2O3 |
| Net Charge | 0 |
| Average Mass | 322.364 |
| Monoisotopic Mass | 322.13174 |
| SMILES | CC(=O)CCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H18N2O3/c1-14(22)12-13-17-18(23)20(15-8-4-2-5-9-15)21(19(17)24)16-10-6-3-7-11-16/h2-11,17H,12-13H2,1H3 |
| InChIKey | LGYTZKPVOAIUKX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kebuzone (CHEBI:31749) has functional parent phenylbutazone (CHEBI:48574) |
| kebuzone (CHEBI:31749) has role non-narcotic analgesic (CHEBI:35481) |
| kebuzone (CHEBI:31749) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| kebuzone (CHEBI:31749) is a methyl ketone (CHEBI:51867) |
| kebuzone (CHEBI:31749) is a pyrazolidines (CHEBI:38312) |
| INNs | Source |
|---|---|
| kebuzone | KEGG DRUG |
| kébuzone | WHO MedNet |
| kebuzonum | ChemIDplus |
| quebuzona | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,2-Diphenyl-4-(gamma-ketobutyl)-3,5-pyrazolidinedione | ChemIDplus |
| 4-(3-Oxobutyl)-1,2-diphenyl-3,5-pyrazolidinedione | ChemIDplus |
| Ketophenylbutazone | KEGG DRUG |
| Ketophenylbutazonum | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1522 | DrugCentral |
| D01567 | KEGG DRUG |
| HMDB0041914 | HMDB |
| Kebuzone | Wikipedia |
| WO2007128412 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:308507 | Reaxys |
| CAS:853-34-9 | KEGG DRUG |
| CAS:853-34-9 | ChemIDplus |
| Citations |
|---|