EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N2O3 |
| Net Charge | 0 |
| Average Mass | 354.450 |
| Monoisotopic Mass | 354.19434 |
| SMILES | COC(=O)C1C(O)CCC2CN3CCc4c(nc5ccccc45)C3CC21 |
| InChI | InChI=1S/C21H26N2O3/c1-26-21(25)19-15-10-17-20-14(13-4-2-3-5-16(13)22-20)8-9-23(17)11-12(15)6-7-18(19)24/h2-5,12,15,17-19,22,24H,6-11H2,1H3 |
| InChIKey | BLGXFZZNTVWLAY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 17-hydroxy-20ξ-yohimban-16-carboxylate (CHEBI:48565) is a methyl ester (CHEBI:25248) |
| methyl 17-hydroxy-20ξ-yohimban-16-carboxylate (CHEBI:48565) is a organic heteropentacyclic compound (CHEBI:38164) |
| methyl 17-hydroxy-20ξ-yohimban-16-carboxylate (CHEBI:48565) is a yohimban alkaloid (CHEBI:27358) |
| Incoming Relation(s) |
| allo-yohimbine (CHEBI:48567) is a methyl 17-hydroxy-20ξ-yohimban-16-carboxylate (CHEBI:48565) |
| pseudoyohimbine (CHEBI:141949) is a methyl 17-hydroxy-20ξ-yohimban-16-carboxylate (CHEBI:48565) |
| rauwolscine (CHEBI:48562) is a methyl 17-hydroxy-20ξ-yohimban-16-carboxylate (CHEBI:48565) |
| yohimbine (CHEBI:10093) is a methyl 17-hydroxy-20ξ-yohimban-16-carboxylate (CHEBI:48565) |
| IUPAC Name |
|---|
| methyl 17-hydroxy-20ξ-yohimban-16-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| LSM-1614 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:97273 | Beilstein |