EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N2O3 |
| Net Charge | 0 |
| Average Mass | 354.450 |
| Monoisotopic Mass | 354.19434 |
| SMILES | [H][C@]12CC[C@H](O)[C@H](C(=O)OC)[C@@]1([H])C[C@@]1([H])c3nc4ccccc4c3CCN1C2 |
| InChI | InChI=1S/C21H26N2O3/c1-26-21(25)19-15-10-17-20-14(13-4-2-3-5-16(13)22-20)8-9-23(17)11-12(15)6-7-18(19)24/h2-5,12,15,17-19,22,24H,6-11H2,1H3/t12-,15+,17+,18+,19-/m1/s1 |
| InChIKey | BLGXFZZNTVWLAY-FJDMERLMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| allo-yohimbine (CHEBI:48567) is a methyl 17-hydroxy-20ξ-yohimban-16-carboxylate (CHEBI:48565) |
| IUPAC Name |
|---|
| methyl 17α-hydroxy-20α-yohimban-16α-carboxylate |
| Synonyms | Source |
|---|---|
| Alloyohimbin | ChemIDplus |
| alloyohimbine | ChemIDplus |
| (16α,17α,20α)-17-hydroxyyohimban-16-carboxylic acid methyl ester | ChemIDplus |
| methyl (16α,17α,20α)-17-hydroxyyohimban-16-carboxylate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:97278 | Beilstein |
| CAS:522-94-1 | ChemIDplus |