EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:141949 - pseudoyohimbine
| Formula | C21H26N2O3 |
| Net Charge | 0 |
| Average Mass | 354.450 |
| Monoisotopic Mass | 354.19434 |
| SMILES | [H][C@@]12CC[C@H](O)[C@H](C(=O)OC)[C@@]1([H])C[C@]1([H])c3nc4ccccc4c3CCN1C2 |
| InChI | InChI=1S/C21H26N2O3/c1-26-21(25)19-15-10-17-20-14(13-4-2-3-5-16(13)22-20)8-9-23(17)11-12(15)6-7-18(19)24/h2-5,12,15,17-19,22,24H,6-11H2,1H3/t12-,15-,17+,18-,19+/m0/s1 |
| InChIKey | BLGXFZZNTVWLAY-AECJZGCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Catharanthus trichophyllus (ncbitaxon:319559) | root (BTO:0001188) | PubMed (1263083) | |
| Uncaria callophylla (IPNI:768220-1) | stem (BTO:0001300) | Article (Goh, S.H. and Junan, S.A.A. (1985) Alkaloids of Uncaria callophylla. Phytochemistry, 24(4), 880-881.) | |
| Uncaria attenuata (ncbitaxon:1840405) | leaf (BTO:0000713) | Article (Phillipson, J.D. and Hemingway, S.R. (1975) Alkaloids of Uncaria attenuata, U. orientalis and U. canescens. Phytochemistry, 14, 1855-1863.) | |
| Rauvolfia canescens (IPNI:81522-1) | root (BTO:0001188) | Article (Stoll, A. and Hofmann, A. (1955) Canescine and pseudoyohimbine from the roots of Rauwolfia canescens L. J. Am. Chem. Soc., 77(3), 820-821.) | |
| Uncaria borneensis (IPNI:768216-1) | leaf (BTO:0000713) | Article (Kam, T.S., Lee, K.H. and Goh, S.H. (1992) Alkaloid distribution in Malaysian Uncaria. Phytochemistry, 31(6), 2031-2034.) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pseudoyohimbine (CHEBI:141949) is a methyl 17-hydroxy-20ξ-yohimban-16-carboxylate (CHEBI:48565) |
| IUPAC Name |
|---|
| methyl (3β,16α,17α)-17-hydroxyyohimban-16-carboxylate |
| Synonyms | Source |
|---|---|
| (3R)-17α-hydroxyyohimban-16α-carboxylic acid methyl ester | ChEBI |
| (3β)-17α-hydroxyyohimban-16α-carboxylic acid methyl ester | ChEBI |
| pseudoyohimbine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:84-37-7 | ChemIDplus |
| Citations |
|---|