EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N2.HCl |
| Net Charge | 0 |
| Average Mass | 236.746 |
| Monoisotopic Mass | 236.10803 |
| SMILES | Cc1cccc([C@@H](C)c2cncn2)c1C.Cl |
| InChI | InChI=1S/C13H16N2.ClH/c1-9-5-4-6-12(10(9)2)11(3)13-7-14-8-15-13;/h4-8,11H,1-3H3,(H,14,15);1H/t11-;/m1./s1 |
| InChIKey | VPNGEIHDPSLNMU-RFVHGSKJSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levomedetomidine hydrochloride (CHEBI:48557) has part levomedetomidine (CHEBI:48555) |
| levomedetomidine hydrochloride (CHEBI:48557) is a medetomidine hydrochloride (CHEBI:48556) |
| levomedetomidine hydrochloride (CHEBI:48557) is enantiomer of dexmedetomidine hydrochloride (CHEBI:31472) |
| Incoming Relation(s) |
| dexmedetomidine hydrochloride (CHEBI:31472) is enantiomer of levomedetomidine hydrochloride (CHEBI:48557) |
| IUPAC Name |
|---|
| 4-[(1R)-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole hydrochloride |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8441403 | Beilstein |