EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N2 |
| Net Charge | 0 |
| Average Mass | 200.285 |
| Monoisotopic Mass | 200.13135 |
| SMILES | Cc1cccc([C@@H](C)c2cncn2)c1C |
| InChI | InChI=1S/C13H16N2/c1-9-5-4-6-12(10(9)2)11(3)13-7-14-8-15-13/h4-8,11H,1-3H3,(H,14,15)/t11-/m1/s1 |
| InChIKey | CUHVIMMYOGQXCV-LLVKDONJSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levomedetomidine (CHEBI:48555) is a medetomidine (CHEBI:48552) |
| levomedetomidine (CHEBI:48555) is enantiomer of dexmedetomidine (CHEBI:4466) |
| Incoming Relation(s) |
| levomedetomidine hydrochloride (CHEBI:48557) has part levomedetomidine (CHEBI:48555) |
| dexmedetomidine (CHEBI:4466) is enantiomer of levomedetomidine (CHEBI:48555) |
| IUPAC Name |
|---|
| 4-[(1R)-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole |
| Manual Xrefs | Databases |
|---|---|
| 1817 | VSDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5906876 | Beilstein |