EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N2.HCl |
| Net Charge | 0 |
| Average Mass | 236.746 |
| Monoisotopic Mass | 236.10803 |
| SMILES | Cc1cccc([C@H](C)c2cncn2)c1C.Cl |
| InChI | InChI=1S/C13H16N2.ClH/c1-9-5-4-6-12(10(9)2)11(3)13-7-14-8-15-13;/h4-8,11H,1-3H3,(H,14,15);1H/t11-;/m0./s1 |
| InChIKey | VPNGEIHDPSLNMU-MERQFXBCSA-N |
| Roles Classification |
|---|
| Application: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dexmedetomidine hydrochloride (CHEBI:31472) has part dexmedetomidine (CHEBI:4466) |
| dexmedetomidine hydrochloride (CHEBI:31472) has role sedative (CHEBI:35717) |
| dexmedetomidine hydrochloride (CHEBI:31472) is a medetomidine hydrochloride (CHEBI:48556) |
| dexmedetomidine hydrochloride (CHEBI:31472) is enantiomer of levomedetomidine hydrochloride (CHEBI:48557) |
| Incoming Relation(s) |
| levomedetomidine hydrochloride (CHEBI:48557) is enantiomer of dexmedetomidine hydrochloride (CHEBI:31472) |
| IUPAC Name |
|---|
| 4-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole hydrochloride |
| Synonym | Source |
|---|---|
| 4-((S)-α,2,3-trimethylbenzyl)imidazole monohydrochloride | ChemIDplus |
| Brand Name | Source |
|---|---|
| Precedex | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D01205 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8937629 | Beilstein |
| CAS:145108-58-3 | ChemIDplus |