EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O4 |
| Net Charge | 0 |
| Average Mass | 182.175 |
| Monoisotopic Mass | 182.05791 |
| SMILES | O=C(O)CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H10O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1,3,5,10-11H,2,4H2,(H,12,13) |
| InChIKey | DZAUWHJDUNRCTF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(3,4-dihydroxyphenyl)propanoic acid (CHEBI:48400) has functional parent 3-phenylpropionic acid (CHEBI:28631) |
| 3-(3,4-dihydroxyphenyl)propanoic acid (CHEBI:48400) has role antioxidant (CHEBI:22586) |
| 3-(3,4-dihydroxyphenyl)propanoic acid (CHEBI:48400) has role human xenobiotic metabolite (CHEBI:76967) |
| 3-(3,4-dihydroxyphenyl)propanoic acid (CHEBI:48400) is a (dihydroxyphenyl)propanoic acid (CHEBI:149591) |
| 3-(3,4-dihydroxyphenyl)propanoic acid (CHEBI:48400) is conjugate acid of 3-(3,4-dihydroxyphenyl)propanoate (CHEBI:58744) |
| Incoming Relation(s) |
| N1,N8-bis-(dihydrocaffeoyl)spermidine (CHEBI:142881) has functional parent 3-(3,4-dihydroxyphenyl)propanoic acid (CHEBI:48400) |
| dihydrocaffeoyl-CoA (CHEBI:87451) has functional parent 3-(3,4-dihydroxyphenyl)propanoic acid (CHEBI:48400) |
| 3-(3,4-dihydroxyphenyl)propanoate (CHEBI:58744) is conjugate base of 3-(3,4-dihydroxyphenyl)propanoic acid (CHEBI:48400) |
| IUPAC Name |
|---|
| 3-(3,4-dihydroxyphenyl)propanoic acid |
| Synonyms | Source |
|---|---|
| 3,4-dihydroxyphenylpropionic acid | ChemIDplus |
| 3,4-dihydroxyhydrocinnamic acid | ChemIDplus |
| hydrocaffeic acid | ChemIDplus |
| dihydrocaffeic acid | ChemIDplus |
| 3,4-dihydroxybenzenepropanoic acid | ChemIDplus |
| 3-(3,4-dihydroxyphenyl)propionic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000423 | HMDB |
| C10447 | KEGG COMPOUND |
| C00002735 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Gmelin:482169 | Gmelin |
| Reaxys:2213449 | Reaxys |
| CAS:1078-61-1 | ChemIDplus |
| CAS:1078-61-1 | KEGG COMPOUND |
| Citations |
|---|