EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H35N3O6 |
| Net Charge | 0 |
| Average Mass | 473.570 |
| Monoisotopic Mass | 473.25259 |
| SMILES | O=C(CCc1ccc(O)c(O)c1)NCCCCNCCCNC(=O)CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C25H35N3O6/c29-20-8-4-18(16-22(20)31)6-10-24(33)27-14-2-1-12-26-13-3-15-28-25(34)11-7-19-5-9-21(30)23(32)17-19/h4-5,8-9,16-17,26,29-32H,1-3,6-7,10-15H2,(H,27,33)(H,28,34) |
| InChIKey | RNEHQZRKZJSYOL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum quitoense (ncbitaxon:227725) | fruit (BTO:0000486) | PubMed (27292771) | Isolated from fruit pulp extract |
| Solanum tuberosum (ncbitaxon:4113) | tuber (BTO:0001400) | PubMed (15969534) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N1,N8-bis-(dihydrocaffeoyl)spermidine (CHEBI:142881) has functional parent 3-(3,4-dihydroxyphenyl)propanoic acid (CHEBI:48400) |
| N1,N8-bis-(dihydrocaffeoyl)spermidine (CHEBI:142881) has functional parent spermidine (CHEBI:16610) |
| N1,N8-bis-(dihydrocaffeoyl)spermidine (CHEBI:142881) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| N1,N8-bis-(dihydrocaffeoyl)spermidine (CHEBI:142881) has role plant metabolite (CHEBI:76924) |
| N1,N8-bis-(dihydrocaffeoyl)spermidine (CHEBI:142881) is a catechols (CHEBI:33566) |
| N1,N8-bis-(dihydrocaffeoyl)spermidine (CHEBI:142881) is a secondary amino compound (CHEBI:50995) |
| N1,N8-bis-(dihydrocaffeoyl)spermidine (CHEBI:142881) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 3-(3,4-dihydroxyphenyl)-N-[3-({4-[3-(3,4-dihydroxyphenyl)propanamido]butyl}amino)propyl]propanamide |
| Synonym | Source |
|---|---|
| N1,N8-bis-[3-(3,4-dihydroxyphenyl)propanoyl]spermidine | ChEBI |
| Citations |
|---|