EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44N7O19P3S |
| Net Charge | 0 |
| Average Mass | 931.701 |
| Monoisotopic Mass | 931.16255 |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C30H44N7O19P3S/c1-30(2,25(43)28(44)33-8-7-20(40)32-9-10-60-21(41)6-4-16-3-5-17(38)18(39)11-16)13-53-59(50,51)56-58(48,49)52-12-19-24(55-57(45,46)47)23(42)29(54-19)37-15-36-22-26(31)34-14-35-27(22)37/h3,5,11,14-15,19,23-25,29,38-39,42-43H,4,6-10,12-13H2,1-2H3,(H,32,40)(H,33,44)(H,48,49)(H,50,51)(H2,31,34,35)(H2,45,46,47)/t19-,23-,24-,25+,29-/m1/s1 |
| InChIKey | NDSCGRAEWDSLKF-FUEUKBNZSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrocaffeoyl-CoA (CHEBI:87451) has functional parent 3-(3,4-dihydroxyphenyl)propanoic acid (CHEBI:48400) |
| dihydrocaffeoyl-CoA (CHEBI:87451) is a acyl-CoA (CHEBI:17984) |
| dihydrocaffeoyl-CoA (CHEBI:87451) is conjugate acid of dihydrocaffeoyl-CoA(4−) (CHEBI:87137) |
| Incoming Relation(s) |
| dihydrocaffeoyl-CoA(4−) (CHEBI:87137) is conjugate base of dihydrocaffeoyl-CoA (CHEBI:87451) |
| Synonyms | Source |
|---|---|
| hydrocaffeoyl-coenzyme A | ChEBI |
| 3-(3,4-dihydroxyphenyl)propanoyl-CoA | ChEBI |
| 3-(3,4-dihydroxyphenyl)propanoyl-coenzyme A | ChEBI |
| hydrocaffeoyl-CoA | ChEBI |
| dihydrocaffeoyl-coenzyme A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-18003 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22760301 | Reaxys |