EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O4 |
| Net Charge | 0 |
| Average Mass | 188.223 |
| Monoisotopic Mass | 188.10486 |
| SMILES | O=C(O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C9H16O4/c10-8(11)6-4-2-1-3-5-7-9(12)13/h1-7H2,(H,10,11)(H,12,13) |
| InChIKey | BDJRBEYXGGNYIS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Carthamus oxyacantha (ncbitaxon:122010) | aerial part (BTO:0001658) | PubMed (22060189) | Crude ethanolic extract of aerial parts |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nonanedioic acid (CHEBI:48131) has role antibacterial agent (CHEBI:33282) |
| nonanedioic acid (CHEBI:48131) has role antineoplastic agent (CHEBI:35610) |
| nonanedioic acid (CHEBI:48131) has role dermatologic drug (CHEBI:50177) |
| nonanedioic acid (CHEBI:48131) has role plant metabolite (CHEBI:76924) |
| nonanedioic acid (CHEBI:48131) is a dicarboxylic fatty acid (CHEBI:189840) |
| nonanedioic acid (CHEBI:48131) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| nonanedioic acid (CHEBI:48131) is conjugate acid of azelaate (CHEBI:132955) |
| nonanedioic acid (CHEBI:48131) is conjugate acid of azelaate(2−) (CHEBI:78208) |
| Incoming Relation(s) |
| 1-O-hexadecyl-2-(8-carboxyoctanoyl)-sn-glycero-3-phosphocholine (CHEBI:138940) has functional parent nonanedioic acid (CHEBI:48131) |
| 1-azelaoyl-sn-glycero-3-phosphocholine (CHEBI:91219) has functional parent nonanedioic acid (CHEBI:48131) |
| 1-palmitoyl-2-azelaoyl-sn-glycero-3-phosphocholine (CHEBI:61817) has functional parent nonanedioic acid (CHEBI:48131) |
| 2-azelaoyl-sn-glycero-3-phosphocholine (CHEBI:91220) has functional parent nonanedioic acid (CHEBI:48131) |
| dimethyl azelate (CHEBI:194206) has functional parent nonanedioic acid (CHEBI:48131) |
| nonanedioic acid monoglycoside (CHEBI:142428) has functional parent nonanedioic acid (CHEBI:48131) |
| azelaate (CHEBI:132955) is conjugate base of nonanedioic acid (CHEBI:48131) |
| azelaate(2−) (CHEBI:78208) is conjugate base of nonanedioic acid (CHEBI:48131) |
| IUPAC Name |
|---|
| nonanedioic acid |
| Synonyms | Source |
|---|---|
| 1,7-dicarboxyheptane | NIST Chemistry WebBook |
| 1,7-Heptanedicarboxylic acid | KEGG COMPOUND |
| 1,9-nonanedioic acid | ChemIDplus |
| acide azélaïque | ChemIDplus |
| acidum azelaicum | ChemIDplus |
| anchoic acid | NIST Chemistry WebBook |
| Brand Names | Source |
|---|---|
| Azelex | DrugBank |
| Finacea | DrugBank |
| Skinoren | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 270 | DrugCentral |
| AZ1 | PDBeChem |
| Azelaic_Acid | Wikipedia |
| C08261 | KEGG COMPOUND |
| CPD0-1265 | MetaCyc |
| D03034 | KEGG DRUG |
| DB00548 | DrugBank |
| HMDB0000784 | HMDB |
| LMFA01170054 | LIPID MAPS |
| Citations |
|---|