EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O9 |
| Net Charge | 0 |
| Average Mass | 350.364 |
| Monoisotopic Mass | 350.15768 |
| SMILES | O=C(O)CCCCCCCC(=O)OC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C15H26O9/c16-8-9-12(20)13(21)14(22)15(23-9)24-11(19)7-5-3-1-2-4-6-10(17)18/h9,12-16,20-22H,1-8H2,(H,17,18) |
| InChIKey | DUUKOTRWWRPSNV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nicotiana tabacum (ncbitaxon:4097) | cell suspension culture (BTO:0000221) | PubMed (27956183) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nonanedioic acid monoglycoside (CHEBI:142428) has functional parent nonanedioic acid (CHEBI:48131) |
| nonanedioic acid monoglycoside (CHEBI:142428) has role plant metabolite (CHEBI:76924) |
| nonanedioic acid monoglycoside (CHEBI:142428) is a dicarboxylic acid monoester (CHEBI:36244) |
| nonanedioic acid monoglycoside (CHEBI:142428) is a glycoside (CHEBI:24400) |
| nonanedioic acid monoglycoside (CHEBI:142428) is a organic hydroxy compound (CHEBI:33822) |
| IUPAC Name |
|---|
| 1-O-(8-carboxyoctanoyl)hexopyranose |
| Synonyms | Source |
|---|---|
| AzAG | ChEBI |
| azelaic acid glycoside | ChEBI |
| azelaic acid monoglycoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:30694522 | Reaxys |
| Citations |
|---|