EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20O4 |
| Net Charge | 0 |
| Average Mass | 216.277 |
| Monoisotopic Mass | 216.13616 |
| SMILES | COC(=O)CCCCCCCC(=O)OC |
| InChI | InChI=1S/C11H20O4/c1-14-10(12)8-6-4-3-5-7-9-11(13)15-2/h3-9H2,1-2H3 |
| InChIKey | DRUKNYVQGHETPO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pinus sibirica (ncbitaxon:62752) | - | DOI (10.1002/cbdv.201600203) | Found in needles and twigs. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethyl azelate (CHEBI:194206) has functional parent nonanedioic acid (CHEBI:48131) |
| dimethyl azelate (CHEBI:194206) has role plant metabolite (CHEBI:76924) |
| dimethyl azelate (CHEBI:194206) is a diester (CHEBI:51307) |
| dimethyl azelate (CHEBI:194206) is a fatty acid methyl ester (CHEBI:4986) |
| IUPAC Name |
|---|
| dimethyl nonanedioate |
| Synonyms | Source |
|---|---|
| 1,9-nonanedioic acid dimethyl ester | ChEBI |
| azelaic acid dimethyl ester | ChEBI |
| azelaic acid, dimethyl ester | ChEBI |
| dimethyl nonane-1,9-dioate | ChEBI |
| methyl azelate | NIST Chemistry WebBook |
| nonanedioic acid 1,9-dimethyl ester | ChEBI |
| Citations |
|---|