EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H34O22 |
| Net Charge | 0 |
| Average Mass | 914.734 |
| Monoisotopic Mass | 914.15417 |
| SMILES | O=C(O[C@@H]1Cc2c(O)cc(O)cc2O[C@@H]1c1cc(O)c(O)c(O)c1-c1c([C@H]2Oc3cc(O)cc(O)c3C[C@H]2OC(=O)c2cc(O)c(O)c(O)c2)cc(O)c(O)c1O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C44H34O22/c45-15-5-21(47)17-11-31(65-43(61)13-1-23(49)35(55)24(50)2-13)41(63-29(17)7-15)19-9-27(53)37(57)39(59)33(19)34-20(10-28(54)38(58)40(34)60)42-32(12-18-22(48)6-16(46)8-30(18)64-42)66-44(62)14-3-25(51)36(56)26(52)4-14/h1-10,31-32,41-42,45-60H,11-12H2/t31-,32-,41-,42-/m1/s1 |
| InChIKey | YUULFXAQUWEYNP-GXAWFILRSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camellia sinensis (ncbitaxon:4442) | leaf (BTO:0000713) | DOI (10.1248/cpb.31.3906) | Species also known as Thea sinensis. |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. melanin synthesis inhibitor A depigmentation agent which inhibits the synthesis of melanin. anti-inflammatory agent Any compound that has anti-inflammatory effects. hepatoprotective agent Any compound that is able to prevent damage to the liver. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| theasinensin A (CHEBI:9518) has functional parent (−)-epigallocatechin 3-gallate (CHEBI:4806) |
| theasinensin A (CHEBI:9518) has role anti-inflammatory agent (CHEBI:67079) |
| theasinensin A (CHEBI:9518) has role anticoronaviral agent (CHEBI:149553) |
| theasinensin A (CHEBI:9518) has role apoptosis inducer (CHEBI:68495) |
| theasinensin A (CHEBI:9518) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| theasinensin A (CHEBI:9518) has role hepatoprotective agent (CHEBI:62868) |
| theasinensin A (CHEBI:9518) has role hypoglycemic agent (CHEBI:35526) |
| theasinensin A (CHEBI:9518) has role melanin synthesis inhibitor (CHEBI:64933) |
| theasinensin A (CHEBI:9518) has role plant metabolite (CHEBI:76924) |
| theasinensin A (CHEBI:9518) is a biflavonoid (CHEBI:50128) |
| theasinensin A (CHEBI:9518) is a gallate ester (CHEBI:37576) |
| theasinensin A (CHEBI:9518) is a proanthocyanidin (CHEBI:26267) |
| IUPAC Name |
|---|
| (4,4',5,5',6,6'-hexahydroxy[biphenyl]-2,2'-diyl)bis[(2R,3R)-5,7-dihydroxy-3,4-dihydro-2H-chromene-2,3-diyl] bis(3,4,5-trihydroxybenzoate) |
| Synonyms | Source |
|---|---|
| (4,4',5,5',6,6'-hexahydroxy[1,1'-biphenyl]-2,2'-diyl)bis{[(2R,3R)-5,7-dihydroxy-3,4-dihydro-2H-1-benzopyran-2,3-diyl]} bis(3,4,5-trihydroxybenzoate) | IUPAC |
| theasinensin A | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 390965 | ChemSpider |
| C00001010 | KNApSAcK |
| C09972 | KEGG COMPOUND |
| FDB018261 | FooDB |
| HMDB0038360 | HMDB |
| LMPK12030006 | LIPID MAPS |
| Theasinensin_A | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:89064-31-3 | KEGG COMPOUND |
| Citations |
|---|