EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H34O22 |
| Net Charge | 0 |
| Average Mass | 914.734 |
| Monoisotopic Mass | 914.15417 |
| SMILES | O=C(O[C@@H]1Cc2c(O)cc(O)cc2O[C@@H]1c1cc(O)c(O)c(O)c1-c1c([C@H]2Oc3cc(O)cc(O)c3C[C@H]2OC(=O)c2cc(O)c(O)c(O)c2)cc(O)c(O)c1O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C44H34O22/c45-15-5-21(47)17-11-31(65-43(61)13-1-23(49)35(55)24(50)2-13)41(63-29(17)7-15)19-9-27(53)37(57)39(59)33(19)34-20(10-28(54)38(58)40(34)60)42-32(12-18-22(48)6-16(46)8-30(18)64-42)66-44(62)14-3-25(51)36(56)26(52)4-14/h1-10,31-32,41-42,45-60H,11-12H2/t31-,32-,41-,42-/m1/s1 |
| InChIKey | YUULFXAQUWEYNP-GXAWFILRSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camellia sinensis (ncbitaxon:4442) | leaf (BTO:0000713) | DOI (10.1248/cpb.31.3906) | Species also known as Thea sinensis. |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. hypoglycemic agent A drug which lowers the blood glucose level. melanin synthesis inhibitor A depigmentation agent which inhibits the synthesis of melanin. anti-inflammatory agent Any compound that has anti-inflammatory effects. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| theasinensin A (CHEBI:9518) has functional parent (−)-epigallocatechin 3-gallate (CHEBI:4806) |
| theasinensin A (CHEBI:9518) has role anti-inflammatory agent (CHEBI:67079) |
| theasinensin A (CHEBI:9518) has role anticoronaviral agent (CHEBI:149553) |
| theasinensin A (CHEBI:9518) has role apoptosis inducer (CHEBI:68495) |
| theasinensin A (CHEBI:9518) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| theasinensin A (CHEBI:9518) has role hepatoprotective agent (CHEBI:62868) |
| theasinensin A (CHEBI:9518) has role hypoglycemic agent (CHEBI:35526) |
| theasinensin A (CHEBI:9518) has role melanin synthesis inhibitor (CHEBI:64933) |
| theasinensin A (CHEBI:9518) has role plant metabolite (CHEBI:76924) |
| theasinensin A (CHEBI:9518) is a biflavonoid (CHEBI:50128) |
| theasinensin A (CHEBI:9518) is a gallate ester (CHEBI:37576) |
| theasinensin A (CHEBI:9518) is a proanthocyanidin (CHEBI:26267) |
| IUPAC Name |
|---|
| (4,4',5,5',6,6'-hexahydroxy[biphenyl]-2,2'-diyl)bis[(2R,3R)-5,7-dihydroxy-3,4-dihydro-2H-chromene-2,3-diyl] bis(3,4,5-trihydroxybenzoate) |
| Synonyms | Source |
|---|---|
| (4,4',5,5',6,6'-hexahydroxy[1,1'-biphenyl]-2,2'-diyl)bis{[(2R,3R)-5,7-dihydroxy-3,4-dihydro-2H-1-benzopyran-2,3-diyl]} bis(3,4,5-trihydroxybenzoate) | IUPAC |
| theasinensin A | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 390965 | ChemSpider |
| C00001010 | KNApSAcK |
| C09972 | KEGG COMPOUND |
| FDB018261 | FooDB |
| HMDB0038360 | HMDB |
| LMPK12030006 | LIPID MAPS |
| Theasinensin_A | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:89064-31-3 | KEGG COMPOUND |
| Citations |
|---|