EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO4 |
| Net Charge | 0 |
| Average Mass | 159.141 |
| Monoisotopic Mass | 159.05316 |
| SMILES | C=C(CC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H9NO4/c1-3(5(8)9)2-4(7)6(10)11/h4H,1-2,7H2,(H,8,9)(H,10,11) |
| InChIKey | RCCMXKJGURLWPB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methyleneglutamic acid (CHEBI:48029) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Incoming Relation(s) |
| 4-methylene-D-glutamic acid (CHEBI:48032) is a 4-methyleneglutamic acid (CHEBI:48029) |
| 4-methylene-L-glutamic acid (CHEBI:48031) is a 4-methyleneglutamic acid (CHEBI:48029) |
| IUPAC Names |
|---|
| 2-amino-4-methylidenepentanedioic acid |
| 4-methylideneglutamic acid |
| Synonyms | Source |
|---|---|
| 4-methyleneglutamic acid | IUPAC |
| 4-methylene-DL-glutamic acid | ChemIDplus |
| γ-methylene glutamic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1724836 | Beilstein |
| Beilstein:1812478 | Beilstein |
| CAS:7150-74-5 | ChemIDplus |