EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:44678 - α-D-glucosamine
| Formula | C6H13NO5 |
| Net Charge | 0 |
| Average Mass | 179.172 |
| Monoisotopic Mass | 179.07937 |
| SMILES | N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O |
| InChI | InChI=1S/C6H13NO5/c7-3-5(10)4(9)2(1-8)12-6(3)11/h2-6,8-11H,1,7H2/t2-,3-,4-,5-,6+/m1/s1 |
| InChIKey | MSWZFWKMSRAUBD-UKFBFLRUSA-N |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-D-glucosamine (CHEBI:44678) has functional parent α-D-glucose (CHEBI:17925) |
| α-D-glucosamine (CHEBI:44678) is a 2-amino-2-deoxy-D-glucopyranose (CHEBI:47977) |
| Incoming Relation(s) |
| α-D-GlcpN-(1→1)-α-D-Galp (CHEBI:152005) has functional parent α-D-glucosamine (CHEBI:44678) |
| α-D-GlcpN-(1→6)-D-GlcpN (CHEBI:150211) has functional parent α-D-glucosamine (CHEBI:44678) |
| α-D-GlcpN-(1→1)-β-D-Glcp (CHEBI:154433) has functional parent α-D-glucosamine (CHEBI:44678) |
| α-D-glucosamine 1-phosphate (CHEBI:27625) has functional parent α-D-glucosamine (CHEBI:44678) |
| α-D-glucosamine 6-phosphate (CHEBI:15873) has functional parent α-D-glucosamine (CHEBI:44678) |
| α-muramic acid (CHEBI:47969) has functional parent α-D-glucosamine (CHEBI:44678) |
| β-D-GlcpN-(1→6)-α-D-GlcpN (CHEBI:154632) has functional parent α-D-glucosamine (CHEBI:44678) |
| IUPAC Name |
|---|
| 2-amino-2-deoxy-α-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 2-amino-2-deoxy-α-D-glucopyranose | ChEBI |
| α-D-glucopyranose, 2-amino-2-deoxy- | ChEBI |
| Citations |
|---|