EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O7 |
| Net Charge | 0 |
| Average Mass | 194.139 |
| Monoisotopic Mass | 194.04265 |
| SMILES | O=C(O)[C@@H]1OC(O)[C@@H](O)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a1211A-1x_1-5]/1/ |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2-,3+,4-,6?/m1/s1 |
| InChIKey | AEMOLEFTQBMNLQ-LSGJAIDOSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-glucopyranuronic acid (CHEBI:79049) is a L-glucuronic acid (CHEBI:79048) |
| L-glucopyranuronic acid (CHEBI:79049) is enantiomer of D-glucopyranuronic acid (CHEBI:47952) |
| Incoming Relation(s) |
| α-L-glucopyranuronic acid (CHEBI:43832) is a L-glucopyranuronic acid (CHEBI:79049) |
| D-glucopyranuronic acid (CHEBI:47952) is enantiomer of L-glucopyranuronic acid (CHEBI:79049) |
| IUPAC Name |
|---|
| L-glucopyranuronic acid |