EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O6 |
| Net Charge | 0 |
| Average Mass | 186.119 |
| Monoisotopic Mass | 186.01644 |
| SMILES | [H]C(C(=O)O)=C([H])C(=O)CC(=O)C(=O)O |
| InChI | InChI=1S/C7H6O6/c8-4(1-2-6(10)11)3-5(9)7(12)13/h1-2H,3H2,(H,10,11)(H,12,13) |
| InChIKey | AZCFLHZUFANAOR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,6-dioxohept-2-enedioic acid (CHEBI:47940) is a heptenedioic acid (CHEBI:24522) |
| 4,6-dioxohept-2-enedioic acid (CHEBI:47940) is a oxo dicarboxylic acid (CHEBI:36145) |
| 4,6-dioxohept-2-enedioic acid (CHEBI:47940) is a β-diketone (CHEBI:67265) |
| 4,6-dioxohept-2-enedioic acid (CHEBI:47940) is conjugate acid of 4,6-dioxohept-2-enedioate (CHEBI:47941) |
| Incoming Relation(s) |
| 3-fumarylpyruvic acid (CHEBI:1506) is a 4,6-dioxohept-2-enedioic acid (CHEBI:47940) |
| 3-maleylpyruvic acid (CHEBI:30859) is a 4,6-dioxohept-2-enedioic acid (CHEBI:47940) |
| 4,6-dioxohept-2-enedioate (CHEBI:47941) is conjugate base of 4,6-dioxohept-2-enedioic acid (CHEBI:47940) |
| IUPAC Name |
|---|
| 4,6-dioxohept-2-enedioic acid |