EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O6 |
| Net Charge | 0 |
| Average Mass | 186.119 |
| Monoisotopic Mass | 186.01644 |
| SMILES | O=C(O)/C=C/C(=O)CC(=O)C(=O)O |
| InChI | InChI=1S/C7H6O6/c8-4(1-2-6(10)11)3-5(9)7(12)13/h1-2H,3H2,(H,10,11)(H,12,13)/b2-1+ |
| InChIKey | AZCFLHZUFANAOR-OWOJBTEDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-fumarylpyruvic acid (CHEBI:1506) has functional parent pyruvic acid (CHEBI:32816) |
| 3-fumarylpyruvic acid (CHEBI:1506) is a 4,6-dioxohept-2-enedioic acid (CHEBI:47940) |
| 3-fumarylpyruvic acid (CHEBI:1506) is a β-diketone (CHEBI:67265) |
| 3-fumarylpyruvic acid (CHEBI:1506) is conjugate acid of 3-fumarylpyruvate(2−) (CHEBI:16854) |
| Incoming Relation(s) |
| 3-fumarylpyruvate(2−) (CHEBI:16854) is conjugate base of 3-fumarylpyruvic acid (CHEBI:1506) |
| IUPAC Name |
|---|
| (2E)-4,6-dioxohept-2-enedioic acid |
| Manual Xrefs | Databases |
|---|---|
| C02514 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1725757 | Reaxys |