EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H4O6 |
| Net Charge | -2 |
| Average Mass | 184.103 |
| Monoisotopic Mass | 184.00189 |
| SMILES | [H]C(C(=O)[O-])=C([H])C(=O)CC(=O)C(=O)[O-] |
| InChI | InChI=1S/C7H6O6/c8-4(1-2-6(10)11)3-5(9)7(12)13/h1-2H,3H2,(H,10,11)(H,12,13)/p-2 |
| InChIKey | AZCFLHZUFANAOR-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,6-dioxohept-2-enedioate (CHEBI:47941) is a heptenedioate (CHEBI:24521) |
| 4,6-dioxohept-2-enedioate (CHEBI:47941) is a oxo dicarboxylate (CHEBI:36147) |
| 4,6-dioxohept-2-enedioate (CHEBI:47941) is conjugate base of 4,6-dioxohept-2-enedioic acid (CHEBI:47940) |
| Incoming Relation(s) |
| 3-fumarylpyruvate(2−) (CHEBI:16854) is a 4,6-dioxohept-2-enedioate (CHEBI:47941) |
| 3-maleylpyruvate(2−) (CHEBI:16727) is a 4,6-dioxohept-2-enedioate (CHEBI:47941) |
| 4,6-dioxohept-2-enedioic acid (CHEBI:47940) is conjugate acid of 4,6-dioxohept-2-enedioate (CHEBI:47941) |
| IUPAC Name |
|---|
| 4,6-dioxohept-2-enedioate |