EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | [H]C(=O)C[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3/t10-/m0/s1 |
| InChIKey | NEHNMFOYXAPHSD-JTQLQIEISA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-(−)-citronellal (CHEBI:368) is a citronellal (CHEBI:47856) |
| (S)-(−)-citronellal (CHEBI:368) is enantiomer of (R)-(+)-citronellal (CHEBI:299) |
| Incoming Relation(s) |
| (S)-citronellalthiosemicarbazonate (CHEBI:156466) has functional parent (S)-(−)-citronellal (CHEBI:368) |
| (R)-(+)-citronellal (CHEBI:299) is enantiomer of (S)-(−)-citronellal (CHEBI:368) |
| IUPAC Name |
|---|
| (3S)-3,7-dimethyloct-6-enal |
| Synonyms | Source |
|---|---|
| (3S)-3,7-dimethyl-6-octenal | ChemIDplus |
| (3S)-(−)-citronellal | NIST Chemistry WebBook |
| (S)-3,7-dimethyl-6-octenal | ChemIDplus |
| (S)-3,7-Dimethyloct-6-enal | KEGG COMPOUND |
| (S)-(-)-Citronellal | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (S)-(−)-citronellal | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00010309 | KNApSAcK |
| C11384 | KEGG COMPOUND |
| LMPR0102010011 | LIPID MAPS |