EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11N |
| Net Charge | 0 |
| Average Mass | 193.249 |
| Monoisotopic Mass | 193.08915 |
| SMILES | C1=Cc2ccccc2Nc2ccccc21 |
| InChI | InChI=1S/C14H11N/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)15-13/h1-10,15H |
| InChIKey | LCGTWRLJTMHIQZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5H-dibenzo[b,f]azepine (CHEBI:47802) has role marine xenobiotic metabolite (CHEBI:83399) |
| 5H-dibenzo[b,f]azepine (CHEBI:47802) is a dibenzoazepine (CHEBI:47804) |
| 5H-dibenzo[b,f]azepine (CHEBI:47802) is a mancude organic heterotricyclic parent (CHEBI:36416) |
| Incoming Relation(s) |
| 5H-dibenzo[b,f]azepin-2-ol (CHEBI:80599) has parent hydride 5H-dibenzo[b,f]azepine (CHEBI:47802) |
| imipramine (CHEBI:47499) has parent hydride 5H-dibenzo[b,f]azepine (CHEBI:47802) |
| IUPAC Name |
|---|
| 5H-dibenzo[b,f]azepine |
| Synonyms | Source |
|---|---|
| 2,2'-iminostilbene | ChemIDplus |
| 2,3,6,7-dibenzazepine | NIST Chemistry WebBook |
| 5H-dibenzazepine | ChEBI |
| 5H-Dibenz[b,f]azepin | NIST Chemistry WebBook |
| 5H-dibenz[b,f]azepine | NIST Chemistry WebBook |
| dibenzazepine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8857 | ChemSpider |
| Dibenzazepine | Wikipedia |
| ONB | PDBeChem |
| Citations |
|---|