EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23ClN2 |
| Net Charge | 0 |
| Average Mass | 314.860 |
| Monoisotopic Mass | 314.15498 |
| SMILES | CN(C)CCCN1c2ccccc2CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H23ClN2/c1-21(2)12-5-13-22-18-7-4-3-6-15(18)8-9-16-10-11-17(20)14-19(16)22/h3-4,6-7,10-11,14H,5,8-9,12-13H2,1-2H3 |
| InChIKey | GDLIGKIOYRNHDA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor An EC 1.8.1.* (oxidoreductase acting on sulfur group of donors, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of trypanothione-disulfide reductase (EC 1.8.1.12). serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clomipramine (CHEBI:47780) has functional parent imipramine (CHEBI:47499) |
| clomipramine (CHEBI:47780) has role anticoronaviral agent (CHEBI:149553) |
| clomipramine (CHEBI:47780) has role antidepressant (CHEBI:35469) |
| clomipramine (CHEBI:47780) has role EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor (CHEBI:77402) |
| clomipramine (CHEBI:47780) has role serotonergic antagonist (CHEBI:48279) |
| clomipramine (CHEBI:47780) has role serotonergic drug (CHEBI:48278) |
| clomipramine (CHEBI:47780) has role serotonin uptake inhibitor (CHEBI:50949) |
| clomipramine (CHEBI:47780) is a dibenzoazepine (CHEBI:47804) |
| clomipramine (CHEBI:47780) is conjugate base of clomipramine(1+) (CHEBI:64209) |
| Incoming Relation(s) |
| clomipramine(1+) (CHEBI:64209) is conjugate acid of clomipramine (CHEBI:47780) |
| IUPAC Name |
|---|
| 3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine |
| Synonyms | Source |
|---|---|
| Clomipramine | KEGG COMPOUND |
| 3-(3-CHLORO-5H-DIBENZO[B,F]AZEPIN-5-YL)-N,N-DIMETHYLPROPAN-1-AMINE | PDBeChem |
| 3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethyl-1-propanamine | NIST Chemistry WebBook |
| 3-chloroimipramine | ChemIDplus |
| chlorimipramine | NIST Chemistry WebBook |
| monochlorimipramine | NIST Chemistry WebBook |
| Citations |
|---|