EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:47780 - clomipramine
| Formula | C19H23ClN2 |
| Net Charge | 0 |
| Average Mass | 314.860 |
| Monoisotopic Mass | 314.15498 |
| SMILES | CN(C)CCCN1c2ccccc2CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H23ClN2/c1-21(2)12-5-13-22-18-7-4-3-6-15(18)8-9-16-10-11-17(20)14-19(16)22/h3-4,6-7,10-11,14H,5,8-9,12-13H2,1-2H3 |
| InChIKey | GDLIGKIOYRNHDA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor An EC 1.8.1.* (oxidoreductase acting on sulfur group of donors, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of trypanothione-disulfide reductase (EC 1.8.1.12). |
| Applications: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clomipramine (CHEBI:47780) has functional parent imipramine (CHEBI:47499) |
| clomipramine (CHEBI:47780) has role anticoronaviral agent (CHEBI:149553) |
| clomipramine (CHEBI:47780) has role antidepressant (CHEBI:35469) |
| clomipramine (CHEBI:47780) has role EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor (CHEBI:77402) |
| clomipramine (CHEBI:47780) has role serotonergic antagonist (CHEBI:48279) |
| clomipramine (CHEBI:47780) has role serotonergic drug (CHEBI:48278) |
| clomipramine (CHEBI:47780) has role serotonin uptake inhibitor (CHEBI:50949) |
| clomipramine (CHEBI:47780) is a dibenzoazepine (CHEBI:47804) |
| clomipramine (CHEBI:47780) is conjugate base of clomipramine(1+) (CHEBI:64209) |
| Incoming Relation(s) |
| clomipramine(1+) (CHEBI:64209) is conjugate acid of clomipramine (CHEBI:47780) |
| IUPAC Name |
|---|
| 3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine |
| Synonyms | Source |
|---|---|
| 3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethyl-1-propanamine | NIST Chemistry WebBook |
| 3-(3-CHLORO-5H-DIBENZO[B,F]AZEPIN-5-YL)-N,N-DIMETHYLPROPAN-1-AMINE | PDBeChem |
| 3-chloroimipramine | ChemIDplus |
| chlorimipramine | NIST Chemistry WebBook |
| Clomipramine | KEGG COMPOUND |
| G 34586 | NIST Chemistry WebBook |
| Citations |
|---|