EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11ClF3NO4 |
| Net Charge | 0 |
| Average Mass | 361.703 |
| Monoisotopic Mass | 361.03287 |
| SMILES | C[C@@H](Oc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1)C(=O)O |
| InChI | InChI=1S/C15H11ClF3NO4/c1-8(14(21)22)23-10-2-4-11(5-3-10)24-13-12(16)6-9(7-20-13)15(17,18)19/h2-8H,1H3,(H,21,22)/t8-/m1/s1 |
| InChIKey | GOCUAJYOYBLQRH-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor An EC 6.4.1.* (C‒C bond-forming ligase) inhibitor that interferes with the action of acetyl-CoA carboxylase (EC 6.4.1.2). |
| Applications: | phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| haloxyfop-P (CHEBI:47454) has role agrochemical (CHEBI:33286) |
| haloxyfop-P (CHEBI:47454) has role EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor (CHEBI:70722) |
| haloxyfop-P (CHEBI:47454) has role phenoxy herbicide (CHEBI:60575) |
| haloxyfop-P (CHEBI:47454) is a 2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid (CHEBI:136694) |
| haloxyfop-P (CHEBI:47454) is conjugate acid of haloxyfop-P(1−) (CHEBI:136690) |
| haloxyfop-P (CHEBI:47454) is enantiomer of (S)-haloxyfop (CHEBI:136692) |
| Incoming Relation(s) |
| haloxyfop-P-methyl (CHEBI:136729) has functional parent haloxyfop-P (CHEBI:47454) |
| haloxyfop (CHEBI:365) has part haloxyfop-P (CHEBI:47454) |
| haloxyfop-P(1−) (CHEBI:136690) is conjugate base of haloxyfop-P (CHEBI:47454) |
| (S)-haloxyfop (CHEBI:136692) is enantiomer of haloxyfop-P (CHEBI:47454) |
| IUPAC Name |
|---|
| (2R)-2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid |
| Synonyms | Source |
|---|---|
| haloxyfop-R | Alan Wood's Pesticides |
| (R)-haloxyfop | ChEBI |
| (+)-haloxyfop | ChEBI |
| (R)-2-{4-[3-chloro-5-(trifluoromethyl)-2-pyridyloxy]phenoxy}propionic acid | Alan Wood's Pesticides |
| (2R)-2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoic acid | Alan Wood's Pesticides |
| (R)-haloxyfop-acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| H1L | PDBeChem |
| haloxyfop-p | Alan Wood's Pesticides |
| 377 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8571970 | Reaxys |
| CAS:95977-29-0 | ChemIDplus |
| CAS:95977-29-0 | Alan Wood's Pesticides |
| Citations |
|---|