EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13ClF3NO4 |
| Net Charge | 0 |
| Average Mass | 375.730 |
| Monoisotopic Mass | 375.04852 |
| SMILES | COC(=O)[C@@H](C)Oc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C16H13ClF3NO4/c1-9(15(22)23-2)24-11-3-5-12(6-4-11)25-14-13(17)7-10(8-21-14)16(18,19)20/h3-9H,1-2H3/t9-/m1/s1 |
| InChIKey | MFSWTRQUCLNFOM-SECBINFHSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor An EC 6.4.1.* (C‒C bond-forming ligase) inhibitor that interferes with the action of acetyl-CoA carboxylase (EC 6.4.1.2). |
| Applications: | proherbicide A compound that, on administration, must undergo chemical conversion by biochemical (enzymatic), chemical (possibly following an enzymatic step), or physical (e.g. photochemical) activation processes before becoming the pharmacologically active herbicide for which it is a proherbicide. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| haloxyfop-P-methyl (CHEBI:136729) has functional parent haloxyfop-P (CHEBI:47454) |
| haloxyfop-P-methyl (CHEBI:136729) has role agrochemical (CHEBI:33286) |
| haloxyfop-P-methyl (CHEBI:136729) has role EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor (CHEBI:70722) |
| haloxyfop-P-methyl (CHEBI:136729) has role proherbicide (CHEBI:136646) |
| haloxyfop-P-methyl (CHEBI:136729) is a methyl 2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate (CHEBI:136720) |
| haloxyfop-P-methyl (CHEBI:136729) is enantiomer of (S)-haloxyfop-methyl (CHEBI:136733) |
| Incoming Relation(s) |
| haloxyfop-methyl (CHEBI:5616) has part haloxyfop-P-methyl (CHEBI:136729) |
| (S)-haloxyfop-methyl (CHEBI:136733) is enantiomer of haloxyfop-P-methyl (CHEBI:136729) |
| IUPAC Name |
|---|
| methyl (2R)-2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate |
| Synonyms | Source |
|---|---|
| haloxyfop-R-methyl | Alan Wood's Pesticides |
| (R)-haloxyfop methyl ester | ChemIDplus |
| methyl (2R)-2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate | Alan Wood's Pesticides |
| methyl (2R)-2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propionate | IUPAC |
| methyl (R)-2-{4-[3-chloro-5-(trifluoromethyl)-2-pyridyloxy]phenoxy}propionate | Alan Wood's Pesticides |
| Brand Name | Source |
|---|---|
| Gallant Super | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1068 | PPDB |
| derivatives/haloxyfop-p-methyl | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13995533 | Reaxys |
| CAS:72619-32-0 | ChemIDplus |
| CAS:72619-32-0 | Alan Wood's Pesticides |
| Citations |
|---|