EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15NO3 |
| Net Charge | 0 |
| Average Mass | 185.223 |
| Monoisotopic Mass | 185.10519 |
| SMILES | [H][C@]12CC[C@]([H])([C@@H](C(=O)O)[C@@H](O)C1)N2C |
| InChI | InChI=1S/C9H15NO3/c1-10-5-2-3-6(10)8(9(12)13)7(11)4-5/h5-8,11H,2-4H2,1H3,(H,12,13)/t5-,6+,7-,8+/m0/s1 |
| InChIKey | PHMBVCPLDPDESM-FKSUSPILSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ecgonine (CHEBI:4743) has role metabolite (CHEBI:25212) |
| ecgonine (CHEBI:4743) has role mouse metabolite (CHEBI:75771) |
| ecgonine (CHEBI:4743) is a 2-hydroxy monocarboxylic acid (CHEBI:49302) |
| ecgonine (CHEBI:4743) is a tropane alkaloid (CHEBI:37332) |
| Incoming Relation(s) |
| O-benzoylecgonine 5-carboxypentyl ester (CHEBI:63312) has functional parent ecgonine (CHEBI:4743) |
| ecgonine benzoate (CHEBI:41001) has functional parent ecgonine (CHEBI:4743) |
| ecgonine methyl ester (CHEBI:31529) has functional parent ecgonine (CHEBI:4743) |
| hapten GNL (CHEBI:63227) has functional parent ecgonine (CHEBI:4743) |
| ioflupane I123 (CHEBI:68855) has functional parent ecgonine (CHEBI:4743) |
| IUPAC Name |
|---|
| (1R,2R,3S,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| Ecgonine | KEGG COMPOUND |
| (-)-Ecgonine | ChemIDplus |
| 1-Ecgonine | ChemIDplus |
| 3β-hydroxy-2β-tropanecarboxylic acid | ChemIDplus |
| [1R*-(Exo,exo)]-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylic acid | NIST Chemistry WebBook |
| 3β-hydroxy-1αH,5αH-tropane-2β-carboxylic acid | NIST Chemistry WebBook |
| Citations |
|---|