EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23FNO2 |
| Net Charge | 0 |
| Average Mass | 427.291 |
| Monoisotopic Mass | 427.07687 |
| SMILES | [H][C@]12CC[C@]([H])([C@@H](C(=O)OC)[C@@H](c3ccc([123I])cc3)C1)N2CCCF |
| InChI | InChI=1S/C18H23FINO2/c1-23-18(22)17-15(12-3-5-13(20)6-4-12)11-14-7-8-16(17)21(14)10-2-9-19/h3-6,14-17H,2,7-11H2,1H3/t14-,15+,16+,17-/m0/s1/i20-4 |
| InChIKey | HXWLAJVUJSVENX-HFIFKADTSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. radiopharmaceutical Any pharmaceutical compound containing a radioisotope. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ioflupane I123 (CHEBI:68855) has functional parent ecgonine (CHEBI:4743) |
| ioflupane I123 (CHEBI:68855) has role antiparkinson drug (CHEBI:48407) |
| ioflupane I123 (CHEBI:68855) has role radioactive imaging agent (CHEBI:37336) |
| ioflupane I123 (CHEBI:68855) has role radiopharmaceutical (CHEBI:35232) |
| ioflupane I123 (CHEBI:68855) is a azabicycloalkane (CHEBI:38295) |
| ioflupane I123 (CHEBI:68855) is a methyl ester (CHEBI:25248) |
| ioflupane I123 (CHEBI:68855) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| methyl (1R,2S,3S,5S)-8-(3-fluoropropyl)-3-[4-(123I)iodophenyl]-8-azabicyclo[3.2.1]octane-2-carboxylate |
| INNs | Source |
|---|---|
| ioflupane (123I) | WHO MedNet |
| ioflupane (123I) | WHO MedNet |
| ioflupano (123I) | WHO MedNet |
| ioflupanum (123I) | WHO MedNet |
| Synonyms | Source |
|---|---|
| (123i)fp-cit | ChEMBL |
| 123I-FP-CIT | ChemIDplus |
| 123I-Ioflupane | ChemIDplus |
| Fp-cit i-123 | ChEMBL |
| Iodine ioflupane (123i) | ChEMBL |
| Ioflupane (123l) | ChEMBL |
| Brand Names | Source |
|---|---|
| Celsunax | ChEMBL |
| Datscan | KEGG DRUG |
| Striascan | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4230 | DrugCentral |
| D10014 | KEGG DRUG |
| Ioflupane_(123I) | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:155798-07-5 | ChemIDplus |
| Citations |
|---|