EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H35N2O8P |
| Net Charge | 0 |
| Average Mass | 510.524 |
| Monoisotopic Mass | 510.21310 |
| SMILES | [H][C@]12CC[C@]([H])([C@@H](C(=O)OCCCCCC(=O)NCCC(=O)O)[C@@H](OP(=O)(O)c3ccccc3)C1)N2C |
| InChI | InChI=1S/C24H35N2O8P/c1-26-17-11-12-19(26)23(20(16-17)34-35(31,32)18-8-4-2-5-9-18)24(30)33-15-7-3-6-10-21(27)25-14-13-22(28)29/h2,4-5,8-9,17,19-20,23H,3,6-7,10-16H2,1H3,(H,25,27)(H,28,29)(H,31,32)/t17-,19+,20-,23+/m0/s1 |
| InChIKey | XCVMZQUXSKASCG-JBYGMCGMSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hapten GNL (CHEBI:63227) has functional parent ecgonine (CHEBI:4743) |
| hapten GNL (CHEBI:63227) has role hapten (CHEBI:59174) |
| hapten GNL (CHEBI:63227) is a azabicycloalkane (CHEBI:38295) |
| hapten GNL (CHEBI:63227) is a organic phosphonate (CHEBI:37592) |
| hapten GNL (CHEBI:63227) is a β-alanine derivative (CHEBI:22823) |
| IUPAC Name |
|---|
| N-[6-({[(1R,2R,3S,5S)-3-{[hydroxy(phenyl)phosphoryl]oxy}-8-methyl-8-azabicyclo[3.2.1]oct-2-yl]carbonyl}oxy)hexanoyl]-β-alanine |
| Synonyms | Source |
|---|---|
| GNL | ChEBI |
| GNL hapten | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8812525 | Reaxys |
| Citations |
|---|