EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15ClN4O6S |
| Net Charge | 0 |
| Average Mass | 414.827 |
| Monoisotopic Mass | 414.04008 |
| SMILES | CCOC(=O)c1ccccc1S(=O)(=O)NC(=O)Nc1nc(Cl)cc(OC)n1 |
| InChI | InChI=1S/C15H15ClN4O6S/c1-3-26-13(21)9-6-4-5-7-10(9)27(23,24)20-15(22)19-14-17-11(16)8-12(18-14)25-2/h4-8H,3H2,1-2H3,(H2,17,18,19,20,22) |
| InChIKey | NSWAMPCUPHPTTC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.2.1.6 (acetolactate synthase) inhibitor An EC 2.2.1.* (transketolase/transaldolase) inhibitor that interferes with the action of acetolactate synthase (EC 2.2.1.6). |
| Applications: | proherbicide A compound that, on administration, must undergo chemical conversion by biochemical (enzymatic), chemical (possibly following an enzymatic step), or physical (e.g. photochemical) activation processes before becoming the pharmacologically active herbicide for which it is a proherbicide. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorimuron-ethyl (CHEBI:47319) has functional parent chlorimuron (CHEBI:81953) |
| chlorimuron-ethyl (CHEBI:47319) has role agrochemical (CHEBI:33286) |
| chlorimuron-ethyl (CHEBI:47319) has role EC 2.2.1.6 (acetolactate synthase) inhibitor (CHEBI:22180) |
| chlorimuron-ethyl (CHEBI:47319) has role proherbicide (CHEBI:136646) |
| chlorimuron-ethyl (CHEBI:47319) is a N-sulfonylurea (CHEBI:76983) |
| chlorimuron-ethyl (CHEBI:47319) is a aromatic ether (CHEBI:35618) |
| chlorimuron-ethyl (CHEBI:47319) is a ethyl ester (CHEBI:23990) |
| chlorimuron-ethyl (CHEBI:47319) is a organochlorine pesticide (CHEBI:38656) |
| chlorimuron-ethyl (CHEBI:47319) is a pyrimidines (CHEBI:39447) |
| chlorimuron-ethyl (CHEBI:47319) is a sulfamoylbenzoate (CHEBI:48471) |
| chlorimuron-ethyl (CHEBI:47319) is conjugate acid of chlorimuron-ethyl(1−) (CHEBI:188144) |
| Incoming Relation(s) |
| chlorimuron-ethyl(1−) (CHEBI:188144) is conjugate base of chlorimuron-ethyl (CHEBI:47319) |
| IUPAC Name |
|---|
| ethyl 2-{[(4-chloro-6-methoxypyrimidin-2-yl)carbamoyl]sulfamoyl}benzoate |
| Synonyms | Source |
|---|---|
| Chlorimuron ethyl | KEGG COMPOUND |
| chlorimuron ethyl ester | ChemIDplus |
| ethyl 2-[[[[(4-chloro-6-methoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]benzoate | Alan Wood's Pesticides |
| ethyl 2-(4-chloro-6-methoxypyrimidin-2-ylcarbamoylsulfamoyl)benzoate | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| CIE | PDBeChem |
| C10943 | KEGG COMPOUND |
| derivatives/chlorimuron-ethyl | Alan Wood's Pesticides |
| 1145 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7448363 | Reaxys |
| CAS:90982-32-4 | KEGG COMPOUND |
| CAS:90982-32-4 | ChemIDplus |
| CAS:90982-32-4 | Alan Wood's Pesticides |
| Citations |
|---|